About N-[[4-[(1R,2S)-2-amino-3-fluoro-1-methoxypropyl]phenyl]methyl]methanesulfonamide
N-[[4-[(1R,2S)-2-amino-3-fluoro-1-methoxypropyl]phenyl]methyl]methanesulfonamide (PubChem CID 90088134) has the molecular formula C12H19FN2O3S
and a molecular weight of 290.36 g/mol. Its IUPAC name is N-[[4-[(1R,2S)-2-amino-3-fluoro-1-methoxypropyl]phenyl]methyl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[[4-[(1R,2S)-2-amino-3-fluoro-1-methoxypropyl]phenyl]methyl]methanesulfonamide |
| PubChem CID | 90088134 |
| Molecular Formula | C12H19FN2O3S |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | N-[[4-[(1R,2S)-2-amino-3-fluoro-1-methoxypropyl]phenyl]methyl]methanesulfonamide |
| SMILES | CO[C@H](c1ccc(CNS(C)(=O)=O)cc1)[C@H](N)CF |
| InChI | InChI=1S/C12H19FN2O3S/c1-18-12(11(14)7-13)10-5-3-9(4-6-10)8-15-19(2,16)17/h3-6,11-12,15H,7-8,14H2,1-2H3/t11-,12-/m1/s1 |
| InChIKey | OTGSAIIYSVLRRN-VXGBXAGGSA-N |
| XLogP | 0.72 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[[4-[(1R,2S)-2-amino-3-fluoro-1-methoxypropyl]phenyl]methyl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[4-[(1R,2S)-2-amino-3-fluoro-1-methoxypropyl]phenyl]methyl]methanesulfonamide?
The IUPAC name of N-[[4-[(1R,2S)-2-amino-3-fluoro-1-methoxypropyl]phenyl]methyl]methanesulfonamide (CID 90088134) is N-[[4-[(1R,2S)-2-amino-3-fluoro-1-methoxypropyl]phenyl]methyl]methanesulfonamide.
What is the SMILES notation for N-[[4-[(1R,2S)-2-amino-3-fluoro-1-methoxypropyl]phenyl]methyl]methanesulfonamide?
The canonical SMILES for N-[[4-[(1R,2S)-2-amino-3-fluoro-1-methoxypropyl]phenyl]methyl]methanesulfonamide is CO[C@H](c1ccc(CNS(C)(=O)=O)cc1)[C@H](N)CF.
What is the InChIKey of N-[[4-[(1R,2S)-2-amino-3-fluoro-1-methoxypropyl]phenyl]methyl]methanesulfonamide?
The InChIKey is OTGSAIIYSVLRRN-VXGBXAGGSA-N. The full InChI is InChI=1S/C12H19FN2O3S/c1-18-12(11(14)7-13)10-5-3-9(4-6-10)8-15-19(2,16)17/h3-6,11-12,15H,7-8,14H2,1-2H3/t11-,12-/m1/s1.
What are the key properties of N-[[4-[(1R,2S)-2-amino-3-fluoro-1-methoxypropyl]phenyl]methyl]methanesulfonamide?
N-[[4-[(1R,2S)-2-amino-3-fluoro-1-methoxypropyl]phenyl]methyl]methanesulfonamide has a molecular weight of 290.36 g/mol, XLogP of 0.72, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[4-[(1R,2S)-2-amino-3-fluoro-1-methoxypropyl]phenyl]methyl]methanesulfonamide is sourced from PubChem (CID 90088134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).