About 2-[(1E)-1-(2-methylphenyl)buta-1,3-dien-2-yl]quinoline
2-[(1E)-1-(2-methylphenyl)buta-1,3-dien-2-yl]quinoline (PubChem CID 90088346) has the molecular formula C20H17N
and a molecular weight of 271.36 g/mol. Its IUPAC name is 2-[(1E)-1-(2-methylphenyl)buta-1,3-dien-2-yl]quinoline.
Molecular Properties
| Compound Name | 2-[(1E)-1-(2-methylphenyl)buta-1,3-dien-2-yl]quinoline |
| PubChem CID | 90088346 |
| Molecular Formula | C20H17N |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | 2-[(1E)-1-(2-methylphenyl)buta-1,3-dien-2-yl]quinoline |
| SMILES | C=C/C(=C\c1ccccc1C)c1ccc2ccccc2n1 |
| InChI | InChI=1S/C20H17N/c1-3-16(14-18-10-5-4-8-15(18)2)20-13-12-17-9-6-7-11-19(17)21-20/h3-14H,1H2,2H3/b16-14+ |
| InChIKey | NKGDYFDTVPTSFO-JQIJEIRASA-N |
| XLogP | 5.27 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1E)-1-(2-methylphenyl)buta-1,3-dien-2-yl]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1E)-1-(2-methylphenyl)buta-1,3-dien-2-yl]quinoline?
The IUPAC name of 2-[(1E)-1-(2-methylphenyl)buta-1,3-dien-2-yl]quinoline (CID 90088346) is 2-[(1E)-1-(2-methylphenyl)buta-1,3-dien-2-yl]quinoline.
What is the SMILES notation for 2-[(1E)-1-(2-methylphenyl)buta-1,3-dien-2-yl]quinoline?
The canonical SMILES for 2-[(1E)-1-(2-methylphenyl)buta-1,3-dien-2-yl]quinoline is C=C/C(=C\c1ccccc1C)c1ccc2ccccc2n1.
What is the InChIKey of 2-[(1E)-1-(2-methylphenyl)buta-1,3-dien-2-yl]quinoline?
The InChIKey is NKGDYFDTVPTSFO-JQIJEIRASA-N. The full InChI is InChI=1S/C20H17N/c1-3-16(14-18-10-5-4-8-15(18)2)20-13-12-17-9-6-7-11-19(17)21-20/h3-14H,1H2,2H3/b16-14+.
What are the key properties of 2-[(1E)-1-(2-methylphenyl)buta-1,3-dien-2-yl]quinoline?
2-[(1E)-1-(2-methylphenyl)buta-1,3-dien-2-yl]quinoline has a molecular weight of 271.36 g/mol, XLogP of 5.27, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1E)-1-(2-methylphenyl)buta-1,3-dien-2-yl]quinoline is sourced from PubChem (CID 90088346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).