About [(2S,5R)-2-cyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] N-oxosulfamate
[(2S,5R)-2-cyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] N-oxosulfamate (PubChem CID 90088587) has the molecular formula C7H8N4O5S
and a molecular weight of 260.23 g/mol. Its IUPAC name is [(2S,5R)-2-cyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] N-oxosulfamate.
Molecular Properties
| Compound Name | [(2S,5R)-2-cyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] N-oxosulfamate |
| PubChem CID | 90088587 |
| Molecular Formula | C7H8N4O5S |
| Molecular Weight | 260.23 g/mol |
| Exact Mass | 260.02 |
| IUPAC Name | [(2S,5R)-2-cyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] N-oxosulfamate |
| SMILES | N#C[C@@H]1CC[C@@H]2CN1C(=O)N2OS(=O)(=O)N=O |
| InChI | InChI=1S/C7H8N4O5S/c8-3-5-1-2-6-4-10(5)7(12)11(6)16-17(14,15)9-13/h5-6H,1-2,4H2/t5-,6+/m0/s1 |
| InChIKey | SYYRMXSWPJYVLW-NTSWFWBYSA-N |
| XLogP | -0.28 |
| TPSA | 120.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.23 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [(2S,5R)-2-cyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] N-oxosulfamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,5R)-2-cyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] N-oxosulfamate?
The IUPAC name of [(2S,5R)-2-cyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] N-oxosulfamate (CID 90088587) is [(2S,5R)-2-cyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] N-oxosulfamate.
What is the SMILES notation for [(2S,5R)-2-cyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] N-oxosulfamate?
The canonical SMILES for [(2S,5R)-2-cyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] N-oxosulfamate is N#C[C@@H]1CC[C@@H]2CN1C(=O)N2OS(=O)(=O)N=O.
What is the InChIKey of [(2S,5R)-2-cyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] N-oxosulfamate?
The InChIKey is SYYRMXSWPJYVLW-NTSWFWBYSA-N. The full InChI is InChI=1S/C7H8N4O5S/c8-3-5-1-2-6-4-10(5)7(12)11(6)16-17(14,15)9-13/h5-6H,1-2,4H2/t5-,6+/m0/s1.
What are the key properties of [(2S,5R)-2-cyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] N-oxosulfamate?
[(2S,5R)-2-cyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] N-oxosulfamate has a molecular weight of 260.23 g/mol, XLogP of -0.28, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,5R)-2-cyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] N-oxosulfamate is sourced from PubChem (CID 90088587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).