C15H14N2OS — CID 9008862
(2S)-3-cyclopropyl-2-thiophen-2-yl-1,2-dihydroquinazolin-4-one (PubChem CID 9008862) has the molecular formula C15H14N2OS and a molecular weight of 270.36 g/mol. Its IUPAC name is (2S)-3-cyclopropyl-2-thiophen-2-yl-1,2-dihydroquinazolin-4-one.
| Compound Name | (2S)-3-cyclopropyl-2-thiophen-2-yl-1,2-dihydroquinazolin-4-one |
|---|---|
| PubChem CID | 9008862 |
| Molecular Formula | C15H14N2OS |
| Molecular Weight | 270.36 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | (2S)-3-cyclopropyl-2-thiophen-2-yl-1,2-dihydroquinazolin-4-one |
| SMILES | O=C1c2ccccc2N[C@H](c2cccs2)N1C1CC1 |
| InChI | InChI=1S/C15H14N2OS/c18-15-11-4-1-2-5-12(11)16-14(13-6-3-9-19-13)17(15)10-7-8-10/h1-6,9-10,14,16H,7-8H2/t14-/m0/s1 |
| InChIKey | YRCJFMXVFKYGPL-AWEZNQCLSA-N |
| XLogP | 3.48 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.36 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |