C10H21NO2 — CID 90089070
2-[[(1R,2S)-2-butoxycyclobutyl]amino]ethanol (PubChem CID 90089070) has the molecular formula C10H21NO2 and a molecular weight of 187.28 g/mol. Its IUPAC name is 2-[[(1R,2S)-2-butoxycyclobutyl]amino]ethanol.
| Compound Name | 2-[[(1R,2S)-2-butoxycyclobutyl]amino]ethanol |
|---|---|
| PubChem CID | 90089070 |
| Molecular Formula | C10H21NO2 |
| Molecular Weight | 187.28 g/mol |
| Exact Mass | 187.16 |
| IUPAC Name | 2-[[(1R,2S)-2-butoxycyclobutyl]amino]ethanol |
| SMILES | CCCCO[C@H]1CC[C@H]1NCCO |
| InChI | InChI=1S/C10H21NO2/c1-2-3-8-13-10-5-4-9(10)11-6-7-12/h9-12H,2-8H2,1H3/t9-,10+/m1/s1 |
| InChIKey | GIZLADJFKQIJMN-ZJUUUORDSA-N |
| XLogP | 0.92 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.28 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|