C17H29NO2 — CID 90089397
4-[2-[(2Z,4E)-4-tert-butylhepta-2,4,6-trienoxy]ethyl]morpholine (PubChem CID 90089397) has the molecular formula C17H29NO2 and a molecular weight of 279.42 g/mol. Its IUPAC name is 4-[2-[(2Z,4E)-4-tert-butylhepta-2,4,6-trienoxy]ethyl]morpholine.
| Compound Name | 4-[2-[(2Z,4E)-4-tert-butylhepta-2,4,6-trienoxy]ethyl]morpholine |
|---|---|
| PubChem CID | 90089397 |
| Molecular Formula | C17H29NO2 |
| Molecular Weight | 279.42 g/mol |
| Exact Mass | 279.22 |
| IUPAC Name | 4-[2-[(2Z,4E)-4-tert-butylhepta-2,4,6-trienoxy]ethyl]morpholine |
| SMILES | C=C/C=C(\C=C/COCCN1CCOCC1)C(C)(C)C |
| InChI | InChI=1S/C17H29NO2/c1-5-7-16(17(2,3)4)8-6-12-19-13-9-18-10-14-20-15-11-18/h5-8H,1,9-15H2,2-4H3/b8-6-,16-7+ |
| InChIKey | LYBTZLKGUBUTKB-JVTGKPJRSA-N |
| XLogP | 3.05 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.42 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|