C13H19N — CID 90089476
3-ethyl-2-[(Z)-prop-1-enyl]-2,3,5,6-tetrahydro-1H-indole (PubChem CID 90089476) has the molecular formula C13H19N and a molecular weight of 189.30 g/mol. Its IUPAC name is 3-ethyl-2-[(Z)-prop-1-enyl]-2,3,5,6-tetrahydro-1H-indole.
| Compound Name | 3-ethyl-2-[(Z)-prop-1-enyl]-2,3,5,6-tetrahydro-1H-indole |
|---|---|
| PubChem CID | 90089476 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | 3-ethyl-2-[(Z)-prop-1-enyl]-2,3,5,6-tetrahydro-1H-indole |
| SMILES | C/C=C\C1NC2=CCCC=C2C1CC |
| InChI | InChI=1S/C13H19N/c1-3-7-12-10(4-2)11-8-5-6-9-13(11)14-12/h3,7-10,12,14H,4-6H2,1-2H3/b7-3- |
| InChIKey | CSUUOPBLNZEZHN-CLTKARDFSA-N |
| XLogP | 3.16 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|