C38H34BNO2S — CID 90089623
3-(8-methyldibenzothiophen-2-yl)-9-(4-methylphenyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazole (PubChem CID 90089623) has the molecular formula C38H34BNO2S and a molecular weight of 579.57 g/mol. Its IUPAC name is 3-(8-methyldibenzothiophen-2-yl)-9-(4-methylphenyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazole.
| Compound Name | 3-(8-methyldibenzothiophen-2-yl)-9-(4-methylphenyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazole |
|---|---|
| PubChem CID | 90089623 |
| Molecular Formula | C38H34BNO2S |
| Molecular Weight | 579.57 g/mol |
| Exact Mass | 579.24 |
| IUPAC Name | 3-(8-methyldibenzothiophen-2-yl)-9-(4-methylphenyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazole |
| SMILES | Cc1ccc(-n2c3ccc(B4OC(C)(C)C(C)(C)O4)cc3c3cc(-c4ccc5sc6ccc(C)cc6c5c4)ccc32)cc1 |
| InChI | InChI=1S/C38H34BNO2S/c1-23-7-13-28(14-8-23)40-33-15-10-25(26-11-18-36-32(21-26)31-19-24(2)9-17-35(31)43-36)20-29(33)30-22-27(12-16-34(30)40)39-41-37(3,4)38(5,6)42-39/h7-22H,1-6H3 |
| InChIKey | BYUIOARGBJVNHG-UHFFFAOYSA-N |
| XLogP | 9.73 |
| TPSA | 23.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.57 |
| LogP ≤ 5 | 9.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|