About 7-(hydroxymethyl)-4H-1,4-benzothiazin-3-one
7-(hydroxymethyl)-4H-1,4-benzothiazin-3-one (PubChem CID 90090000) has the molecular formula C9H9NO2S
and a molecular weight of 195.24 g/mol. Its IUPAC name is 7-(hydroxymethyl)-4H-1,4-benzothiazin-3-one.
Molecular Properties
| Compound Name | 7-(hydroxymethyl)-4H-1,4-benzothiazin-3-one |
| PubChem CID | 90090000 |
| Molecular Formula | C9H9NO2S |
| Molecular Weight | 195.24 g/mol |
| Exact Mass | 195.04 |
| IUPAC Name | 7-(hydroxymethyl)-4H-1,4-benzothiazin-3-one |
| SMILES | O=C1CSc2cc(CO)ccc2N1 |
| InChI | InChI=1S/C9H9NO2S/c11-4-6-1-2-7-8(3-6)13-5-9(12)10-7/h1-3,11H,4-5H2,(H,10,12) |
| InChIKey | JCWQPDXOGKDRGC-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.24 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-(hydroxymethyl)-4H-1,4-benzothiazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(hydroxymethyl)-4H-1,4-benzothiazin-3-one?
The IUPAC name of 7-(hydroxymethyl)-4H-1,4-benzothiazin-3-one (CID 90090000) is 7-(hydroxymethyl)-4H-1,4-benzothiazin-3-one.
What is the SMILES notation for 7-(hydroxymethyl)-4H-1,4-benzothiazin-3-one?
The canonical SMILES for 7-(hydroxymethyl)-4H-1,4-benzothiazin-3-one is O=C1CSc2cc(CO)ccc2N1.
What is the InChIKey of 7-(hydroxymethyl)-4H-1,4-benzothiazin-3-one?
The InChIKey is JCWQPDXOGKDRGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO2S/c11-4-6-1-2-7-8(3-6)13-5-9(12)10-7/h1-3,11H,4-5H2,(H,10,12).
What are the key properties of 7-(hydroxymethyl)-4H-1,4-benzothiazin-3-one?
7-(hydroxymethyl)-4H-1,4-benzothiazin-3-one has a molecular weight of 195.24 g/mol, XLogP of 1.22, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(hydroxymethyl)-4H-1,4-benzothiazin-3-one is sourced from PubChem (CID 90090000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).