C20H15N5O — CID 900901
1,5-diphenyl-N-pyridin-2-yl-1,2,4-triazole-3-carboxamide (PubChem CID 900901) has the molecular formula C20H15N5O and a molecular weight of 341.37 g/mol. Its IUPAC name is 1,5-diphenyl-N-pyridin-2-yl-1,2,4-triazole-3-carboxamide.
| Compound Name | 1,5-diphenyl-N-pyridin-2-yl-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 900901 |
| Molecular Formula | C20H15N5O |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | 1,5-diphenyl-N-pyridin-2-yl-1,2,4-triazole-3-carboxamide |
| SMILES | O=C(Nc1ccccn1)c1nc(-c2ccccc2)n(-c2ccccc2)n1 |
| InChI | InChI=1S/C20H15N5O/c26-20(22-17-13-7-8-14-21-17)18-23-19(15-9-3-1-4-10-15)25(24-18)16-11-5-2-6-12-16/h1-14H,(H,21,22,26) |
| InChIKey | PCZGDUYZOAFJDV-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |