About 5,6-dioxo-N-propan-2-yl-1,4-dihydropyrazine-2-carboxamide
5,6-dioxo-N-propan-2-yl-1,4-dihydropyrazine-2-carboxamide (PubChem CID 90090174) has the molecular formula C8H11N3O3
and a molecular weight of 197.19 g/mol. Its IUPAC name is 5,6-dioxo-N-propan-2-yl-1,4-dihydropyrazine-2-carboxamide.
Molecular Properties
| Compound Name | 5,6-dioxo-N-propan-2-yl-1,4-dihydropyrazine-2-carboxamide |
| PubChem CID | 90090174 |
| Molecular Formula | C8H11N3O3 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | 5,6-dioxo-N-propan-2-yl-1,4-dihydropyrazine-2-carboxamide |
| SMILES | CC(C)NC(=O)c1c[nH]c(=O)c(=O)[nH]1 |
| InChI | InChI=1S/C8H11N3O3/c1-4(2)10-6(12)5-3-9-7(13)8(14)11-5/h3-4H,1-2H3,(H,9,13)(H,10,12)(H,11,14) |
| InChIKey | VLGJIKQQGSSWCI-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 5,6-dioxo-N-propan-2-yl-1,4-dihydropyrazine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dioxo-N-propan-2-yl-1,4-dihydropyrazine-2-carboxamide?
The IUPAC name of 5,6-dioxo-N-propan-2-yl-1,4-dihydropyrazine-2-carboxamide (CID 90090174) is 5,6-dioxo-N-propan-2-yl-1,4-dihydropyrazine-2-carboxamide.
What is the SMILES notation for 5,6-dioxo-N-propan-2-yl-1,4-dihydropyrazine-2-carboxamide?
The canonical SMILES for 5,6-dioxo-N-propan-2-yl-1,4-dihydropyrazine-2-carboxamide is CC(C)NC(=O)c1c[nH]c(=O)c(=O)[nH]1.
What is the InChIKey of 5,6-dioxo-N-propan-2-yl-1,4-dihydropyrazine-2-carboxamide?
The InChIKey is VLGJIKQQGSSWCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3O3/c1-4(2)10-6(12)5-3-9-7(13)8(14)11-5/h3-4H,1-2H3,(H,9,13)(H,10,12)(H,11,14).
What are the key properties of 5,6-dioxo-N-propan-2-yl-1,4-dihydropyrazine-2-carboxamide?
5,6-dioxo-N-propan-2-yl-1,4-dihydropyrazine-2-carboxamide has a molecular weight of 197.19 g/mol, XLogP of -0.80, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dioxo-N-propan-2-yl-1,4-dihydropyrazine-2-carboxamide is sourced from PubChem (CID 90090174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).