C18H20N2O3 — CID 9009021
(2S)-2-(2-hydroxy-3-methoxyphenyl)-3-propyl-1,2-dihydroquinazolin-4-one (PubChem CID 9009021) has the molecular formula C18H20N2O3 and a molecular weight of 312.37 g/mol. Its IUPAC name is (2S)-2-(2-hydroxy-3-methoxyphenyl)-3-propyl-1,2-dihydroquinazolin-4-one.
| Compound Name | (2S)-2-(2-hydroxy-3-methoxyphenyl)-3-propyl-1,2-dihydroquinazolin-4-one |
|---|---|
| PubChem CID | 9009021 |
| Molecular Formula | C18H20N2O3 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | (2S)-2-(2-hydroxy-3-methoxyphenyl)-3-propyl-1,2-dihydroquinazolin-4-one |
| SMILES | CCCN1C(=O)c2ccccc2N[C@@H]1c1cccc(OC)c1O |
| InChI | InChI=1S/C18H20N2O3/c1-3-11-20-17(13-8-6-10-15(23-2)16(13)21)19-14-9-5-4-7-12(14)18(20)22/h4-10,17,19,21H,3,11H2,1-2H3/t17-/m0/s1 |
| InChIKey | GMGZEMQYJCAQDA-KRWDZBQOSA-N |
| XLogP | 3.38 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|