C19H21N3O3 — CID 90090368
8-ethoxy-2-methyl-N-(2-phenoxyethyl)imidazo[1,2-a]pyridine-3-carboxamide (PubChem CID 90090368) has the molecular formula C19H21N3O3 and a molecular weight of 339.40 g/mol. Its IUPAC name is 8-ethoxy-2-methyl-N-(2-phenoxyethyl)imidazo[1,2-a]pyridine-3-carboxamide.
| Compound Name | 8-ethoxy-2-methyl-N-(2-phenoxyethyl)imidazo[1,2-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 90090368 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 8-ethoxy-2-methyl-N-(2-phenoxyethyl)imidazo[1,2-a]pyridine-3-carboxamide |
| SMILES | CCOc1cccn2c(C(=O)NCCOc3ccccc3)c(C)nc12 |
| InChI | InChI=1S/C19H21N3O3/c1-3-24-16-10-7-12-22-17(14(2)21-18(16)22)19(23)20-11-13-25-15-8-5-4-6-9-15/h4-10,12H,3,11,13H2,1-2H3,(H,20,23) |
| InChIKey | VPPLOBWQGSCBKI-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|