C18H27N5O9 — CID 90090722
[3-carbamoyloxy-2-[4-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethylamino]-4-oxobutoxy]propyl] carbamate (PubChem CID 90090722) has the molecular formula C18H27N5O9 and a molecular weight of 457.44 g/mol. Its IUPAC name is [3-carbamoyloxy-2-[4-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethylamino]-4-oxobutoxy]propyl] carbamate.
| Compound Name | [3-carbamoyloxy-2-[4-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethylamino]-4-oxobutoxy]propyl] carbamate |
|---|---|
| PubChem CID | 90090722 |
| Molecular Formula | C18H27N5O9 |
| Molecular Weight | 457.44 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | [3-carbamoyloxy-2-[4-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethylamino]-4-oxobutoxy]propyl] carbamate |
| SMILES | NC(=O)OCC(COC(N)=O)OCCCC(=O)NCCNC(=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C18H27N5O9/c19-17(28)31-10-12(11-32-18(20)29)30-9-1-2-13(24)21-6-7-22-14(25)5-8-23-15(26)3-4-16(23)27/h3-4,12H,1-2,5-11H2,(H2,19,28)(H2,20,29)(H,21,24)(H,22,25) |
| InChIKey | IHUIBNGISYSCSS-UHFFFAOYSA-N |
| XLogP | -2.11 |
| TPSA | 209.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.44 |
| LogP ≤ 5 | -2.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|