C25H20F3N3O4 — CID 90090971
3-[[2-methyl-8-[(2,3,6-trifluorophenyl)methoxy]imidazo[1,2-a]pyridine-3-carbonyl]amino]-3-phenylpropanoic acid (PubChem CID 90090971) has the molecular formula C25H20F3N3O4 and a molecular weight of 483.45 g/mol. Its IUPAC name is 3-[[2-methyl-8-[(2,3,6-trifluorophenyl)methoxy]imidazo[1,2-a]pyridine-3-carbonyl]amino]-3-phenylpropanoic acid.
| Compound Name | 3-[[2-methyl-8-[(2,3,6-trifluorophenyl)methoxy]imidazo[1,2-a]pyridine-3-carbonyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 90090971 |
| Molecular Formula | C25H20F3N3O4 |
| Molecular Weight | 483.45 g/mol |
| Exact Mass | 483.14 |
| IUPAC Name | 3-[[2-methyl-8-[(2,3,6-trifluorophenyl)methoxy]imidazo[1,2-a]pyridine-3-carbonyl]amino]-3-phenylpropanoic acid |
| SMILES | Cc1nc2c(OCc3c(F)ccc(F)c3F)cccn2c1C(=O)NC(CC(=O)O)c1ccccc1 |
| InChI | InChI=1S/C25H20F3N3O4/c1-14-23(25(34)30-19(12-21(32)33)15-6-3-2-4-7-15)31-11-5-8-20(24(31)29-14)35-13-16-17(26)9-10-18(27)22(16)28/h2-11,19H,12-13H2,1H3,(H,30,34)(H,32,33) |
| InChIKey | VLZLNQIANOIDCK-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.45 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|