C25H27FN4O3 — CID 90091617
N-tert-butyl-6-[[2-(4-fluorophenyl)phenyl]methyl]-3-oxido-7,8-dihydro-5H-pyrimido[5,4-f][1,4]oxazepin-3-ium-5-carboxamide (PubChem CID 90091617) has the molecular formula C25H27FN4O3 and a molecular weight of 450.51 g/mol. Its IUPAC name is N-tert-butyl-6-[[2-(4-fluorophenyl)phenyl]methyl]-3-oxido-7,8-dihydro-5H-pyrimido[5,4-f][1,4]oxazepin-3-ium-5-carboxamide.
| Compound Name | N-tert-butyl-6-[[2-(4-fluorophenyl)phenyl]methyl]-3-oxido-7,8-dihydro-5H-pyrimido[5,4-f][1,4]oxazepin-3-ium-5-carboxamide |
|---|---|
| PubChem CID | 90091617 |
| Molecular Formula | C25H27FN4O3 |
| Molecular Weight | 450.51 g/mol |
| Exact Mass | 450.21 |
| IUPAC Name | N-tert-butyl-6-[[2-(4-fluorophenyl)phenyl]methyl]-3-oxido-7,8-dihydro-5H-pyrimido[5,4-f][1,4]oxazepin-3-ium-5-carboxamide |
| SMILES | CC(C)(C)NC(=O)C1c2c[n+]([O-])cnc2OCCN1Cc1ccccc1-c1ccc(F)cc1 |
| InChI | InChI=1S/C25H27FN4O3/c1-25(2,3)28-23(31)22-21-15-30(32)16-27-24(21)33-13-12-29(22)14-18-6-4-5-7-20(18)17-8-10-19(26)11-9-17/h4-11,15-16,22H,12-14H2,1-3H3,(H,28,31) |
| InChIKey | MOVVYQFZVPOMRX-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.51 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|