About 4-formyl-N,N-dimethyl-1,2-dihydroimidazole-3-sulfonamide
4-formyl-N,N-dimethyl-1,2-dihydroimidazole-3-sulfonamide (PubChem CID 90091957) has the molecular formula C6H11N3O3S
and a molecular weight of 205.24 g/mol. Its IUPAC name is 4-formyl-N,N-dimethyl-1,2-dihydroimidazole-3-sulfonamide.
Molecular Properties
| Compound Name | 4-formyl-N,N-dimethyl-1,2-dihydroimidazole-3-sulfonamide |
| PubChem CID | 90091957 |
| Molecular Formula | C6H11N3O3S |
| Molecular Weight | 205.24 g/mol |
| Exact Mass | 205.05 |
| IUPAC Name | 4-formyl-N,N-dimethyl-1,2-dihydroimidazole-3-sulfonamide |
| SMILES | CN(C)S(=O)(=O)N1CNC=C1C=O |
| InChI | InChI=1S/C6H11N3O3S/c1-8(2)13(11,12)9-5-7-3-6(9)4-10/h3-4,7H,5H2,1-2H3 |
| InChIKey | HRKZKBPADDQWKO-UHFFFAOYSA-N |
| XLogP | -1.30 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.24 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-formyl-N,N-dimethyl-1,2-dihydroimidazole-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-formyl-N,N-dimethyl-1,2-dihydroimidazole-3-sulfonamide?
The IUPAC name of 4-formyl-N,N-dimethyl-1,2-dihydroimidazole-3-sulfonamide (CID 90091957) is 4-formyl-N,N-dimethyl-1,2-dihydroimidazole-3-sulfonamide.
What is the SMILES notation for 4-formyl-N,N-dimethyl-1,2-dihydroimidazole-3-sulfonamide?
The canonical SMILES for 4-formyl-N,N-dimethyl-1,2-dihydroimidazole-3-sulfonamide is CN(C)S(=O)(=O)N1CNC=C1C=O.
What is the InChIKey of 4-formyl-N,N-dimethyl-1,2-dihydroimidazole-3-sulfonamide?
The InChIKey is HRKZKBPADDQWKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N3O3S/c1-8(2)13(11,12)9-5-7-3-6(9)4-10/h3-4,7H,5H2,1-2H3.
What are the key properties of 4-formyl-N,N-dimethyl-1,2-dihydroimidazole-3-sulfonamide?
4-formyl-N,N-dimethyl-1,2-dihydroimidazole-3-sulfonamide has a molecular weight of 205.24 g/mol, XLogP of -1.30, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-formyl-N,N-dimethyl-1,2-dihydroimidazole-3-sulfonamide is sourced from PubChem (CID 90091957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).