C15H10ClN3O2 — CID 900922
1-(4-chlorophenyl)-5-phenyl-1,2,4-triazole-3-carboxylic acid (PubChem CID 900922) has the molecular formula C15H10ClN3O2 and a molecular weight of 299.72 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-5-phenyl-1,2,4-triazole-3-carboxylic acid.
| Compound Name | 1-(4-chlorophenyl)-5-phenyl-1,2,4-triazole-3-carboxylic acid |
|---|---|
| PubChem CID | 900922 |
| Molecular Formula | C15H10ClN3O2 |
| Molecular Weight | 299.72 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | 1-(4-chlorophenyl)-5-phenyl-1,2,4-triazole-3-carboxylic acid |
| SMILES | O=C(O)c1nc(-c2ccccc2)n(-c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C15H10ClN3O2/c16-11-6-8-12(9-7-11)19-14(10-4-2-1-3-5-10)17-13(18-19)15(20)21/h1-9H,(H,20,21) |
| InChIKey | JYCWXEPVWKSUOY-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.72 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |