C16H30N2O — CID 90092330
N-cyclohexyl-2,2,6,6-tetramethylpiperidine-4-carboxamide (PubChem CID 90092330) has the molecular formula C16H30N2O and a molecular weight of 266.43 g/mol. Its IUPAC name is N-cyclohexyl-2,2,6,6-tetramethylpiperidine-4-carboxamide.
| Compound Name | N-cyclohexyl-2,2,6,6-tetramethylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 90092330 |
| Molecular Formula | C16H30N2O |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.24 |
| IUPAC Name | N-cyclohexyl-2,2,6,6-tetramethylpiperidine-4-carboxamide |
| SMILES | CC1(C)CC(C(=O)NC2CCCCC2)CC(C)(C)N1 |
| InChI | InChI=1S/C16H30N2O/c1-15(2)10-12(11-16(3,4)18-15)14(19)17-13-8-6-5-7-9-13/h12-13,18H,5-11H2,1-4H3,(H,17,19) |
| InChIKey | ZPQJLRDKKIYHPD-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |