About 2-methyl-4-(5-methyl-3,4-dihydro-2H-chromen-6-yl)-5-thiophen-2-ylpyrazole-3-carbaldehyde
2-methyl-4-(5-methyl-3,4-dihydro-2H-chromen-6-yl)-5-thiophen-2-ylpyrazole-3-carbaldehyde (PubChem CID 90092854) has the molecular formula C19H18N2O2S
and a molecular weight of 338.43 g/mol. Its IUPAC name is 2-methyl-4-(5-methyl-3,4-dihydro-2H-chromen-6-yl)-5-thiophen-2-ylpyrazole-3-carbaldehyde.
Molecular Properties
| Compound Name | 2-methyl-4-(5-methyl-3,4-dihydro-2H-chromen-6-yl)-5-thiophen-2-ylpyrazole-3-carbaldehyde |
| PubChem CID | 90092854 |
| Molecular Formula | C19H18N2O2S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | 2-methyl-4-(5-methyl-3,4-dihydro-2H-chromen-6-yl)-5-thiophen-2-ylpyrazole-3-carbaldehyde |
| SMILES | Cc1c(-c2c(-c3cccs3)nn(C)c2C=O)ccc2c1CCCO2 |
| InChI | InChI=1S/C19H18N2O2S/c1-12-13-5-3-9-23-16(13)8-7-14(12)18-15(11-22)21(2)20-19(18)17-6-4-10-24-17/h4,6-8,10-11H,3,5,9H2,1-2H3 |
| InChIKey | NRJKKJTTWUDFHY-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-4-(5-methyl-3,4-dihydro-2H-chromen-6-yl)-5-thiophen-2-ylpyrazole-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4-(5-methyl-3,4-dihydro-2H-chromen-6-yl)-5-thiophen-2-ylpyrazole-3-carbaldehyde?
The IUPAC name of 2-methyl-4-(5-methyl-3,4-dihydro-2H-chromen-6-yl)-5-thiophen-2-ylpyrazole-3-carbaldehyde (CID 90092854) is 2-methyl-4-(5-methyl-3,4-dihydro-2H-chromen-6-yl)-5-thiophen-2-ylpyrazole-3-carbaldehyde.
What is the SMILES notation for 2-methyl-4-(5-methyl-3,4-dihydro-2H-chromen-6-yl)-5-thiophen-2-ylpyrazole-3-carbaldehyde?
The canonical SMILES for 2-methyl-4-(5-methyl-3,4-dihydro-2H-chromen-6-yl)-5-thiophen-2-ylpyrazole-3-carbaldehyde is Cc1c(-c2c(-c3cccs3)nn(C)c2C=O)ccc2c1CCCO2.
What is the InChIKey of 2-methyl-4-(5-methyl-3,4-dihydro-2H-chromen-6-yl)-5-thiophen-2-ylpyrazole-3-carbaldehyde?
The InChIKey is NRJKKJTTWUDFHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N2O2S/c1-12-13-5-3-9-23-16(13)8-7-14(12)18-15(11-22)21(2)20-19(18)17-6-4-10-24-17/h4,6-8,10-11H,3,5,9H2,1-2H3.
What are the key properties of 2-methyl-4-(5-methyl-3,4-dihydro-2H-chromen-6-yl)-5-thiophen-2-ylpyrazole-3-carbaldehyde?
2-methyl-4-(5-methyl-3,4-dihydro-2H-chromen-6-yl)-5-thiophen-2-ylpyrazole-3-carbaldehyde has a molecular weight of 338.43 g/mol, XLogP of 4.26, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4-(5-methyl-3,4-dihydro-2H-chromen-6-yl)-5-thiophen-2-ylpyrazole-3-carbaldehyde is sourced from PubChem (CID 90092854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).