C8H6F5N3O2 — CID 90093245
4-(1,2,2,3,3-pentafluoropropylamino)pyrimidine-5-carboxylic acid (PubChem CID 90093245) has the molecular formula C8H6F5N3O2 and a molecular weight of 271.15 g/mol. Its IUPAC name is 4-(1,2,2,3,3-pentafluoropropylamino)pyrimidine-5-carboxylic acid.
| Compound Name | 4-(1,2,2,3,3-pentafluoropropylamino)pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 90093245 |
| Molecular Formula | C8H6F5N3O2 |
| Molecular Weight | 271.15 g/mol |
| Exact Mass | 271.04 |
| IUPAC Name | 4-(1,2,2,3,3-pentafluoropropylamino)pyrimidine-5-carboxylic acid |
| SMILES | O=C(O)c1cncnc1NC(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C8H6F5N3O2/c9-6(10)8(12,13)7(11)16-4-3(5(17)18)1-14-2-15-4/h1-2,6-7H,(H,17,18)(H,14,15,16) |
| InChIKey | UQORMCXVSHVFCE-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.15 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|