About indol-2-one;hydrate
indol-2-one;hydrate (PubChem CID 90093449) has the molecular formula C8H7NO2
and a molecular weight of 149.15 g/mol. Its IUPAC name is indol-2-one;hydrate.
Molecular Properties
| Compound Name | indol-2-one;hydrate |
| PubChem CID | 90093449 |
| Molecular Formula | C8H7NO2 |
| Molecular Weight | 149.15 g/mol |
| Exact Mass | 149.05 |
| IUPAC Name | indol-2-one;hydrate |
| SMILES | O.O=C1C=c2ccccc2=N1 |
| InChI | InChI=1S/C8H5NO.H2O/c10-8-5-6-3-1-2-4-7(6)9-8;/h1-5H;1H2 |
| InChIKey | LJOOKYFKAFGXRZ-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.15 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze indol-2-one;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of indol-2-one;hydrate?
The IUPAC name of indol-2-one;hydrate (CID 90093449) is indol-2-one;hydrate.
What is the SMILES notation for indol-2-one;hydrate?
The canonical SMILES for indol-2-one;hydrate is O.O=C1C=c2ccccc2=N1.
What is the InChIKey of indol-2-one;hydrate?
The InChIKey is LJOOKYFKAFGXRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5NO.H2O/c10-8-5-6-3-1-2-4-7(6)9-8;/h1-5H;1H2.
What are the key properties of indol-2-one;hydrate?
indol-2-one;hydrate has a molecular weight of 149.15 g/mol, XLogP of -1.20, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for indol-2-one;hydrate is sourced from PubChem (CID 90093449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).