C75H89O12P3 — CID 90093706
2,2-bis[3-bis(2,4,6-trimethylbenzoyl)phosphanylpropanoyloxymethyl]butyl 3-bis(2,4,6-trimethylbenzoyl)phosphanylpropanoate (PubChem CID 90093706) has the molecular formula C75H89O12P3 and a molecular weight of 1275.45 g/mol. Its IUPAC name is 2,2-bis[3-bis(2,4,6-trimethylbenzoyl)phosphanylpropanoyloxymethyl]butyl 3-bis(2,4,6-trimethylbenzoyl)phosphanylpropanoate.
| Compound Name | 2,2-bis[3-bis(2,4,6-trimethylbenzoyl)phosphanylpropanoyloxymethyl]butyl 3-bis(2,4,6-trimethylbenzoyl)phosphanylpropanoate |
|---|---|
| PubChem CID | 90093706 |
| Molecular Formula | C75H89O12P3 |
| Molecular Weight | 1275.45 g/mol |
| Exact Mass | 1274.56 |
| IUPAC Name | 2,2-bis[3-bis(2,4,6-trimethylbenzoyl)phosphanylpropanoyloxymethyl]butyl 3-bis(2,4,6-trimethylbenzoyl)phosphanylpropanoate |
| SMILES | CCC(COC(=O)CCP(C(=O)c1c(C)cc(C)cc1C)C(=O)c1c(C)cc(C)cc1C)(COC(=O)CCP(C(=O)c1c(C)cc(C)cc1C)C(=O)c1c(C)cc(C)cc1C)COC(=O)CCP(C(=O)c1c(C)cc(C)cc1C)C(=O)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C75H89O12P3/c1-20-75(39-85-60(76)21-24-88(69(79)63-48(8)27-42(2)28-49(63)9)70(80)64-50(10)29-43(3)30-51(64)11,40-86-61(77)22-25-89(71(81)65-52(12)31-44(4)32-53(65)13)72(82)66-54(14)33-45(5)34-55(66)15)41-87-62(78)23-26-90(73(83)67-56(16)35-46(6)36-57(67)17)74(84)68-58(18)37-47(7)38-59(68)19/h27-38H,20-26,39-41H2,1-19H3 |
| InChIKey | OIEGTUJXAMGQCR-UHFFFAOYSA-N |
| XLogP | 17.22 |
| TPSA | 181.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 90 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1275.45 |
| LogP ≤ 5 | 17.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|