C11H12F5N3O2S — CID 90093715
ethyl 2-methylsulfanyl-4-(2,2,3,3,3-pentafluoropropylamino)pyrimidine-5-carboxylate (PubChem CID 90093715) has the molecular formula C11H12F5N3O2S and a molecular weight of 345.29 g/mol. Its IUPAC name is ethyl 2-methylsulfanyl-4-(2,2,3,3,3-pentafluoropropylamino)pyrimidine-5-carboxylate.
| Compound Name | ethyl 2-methylsulfanyl-4-(2,2,3,3,3-pentafluoropropylamino)pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 90093715 |
| Molecular Formula | C11H12F5N3O2S |
| Molecular Weight | 345.29 g/mol |
| Exact Mass | 345.06 |
| IUPAC Name | ethyl 2-methylsulfanyl-4-(2,2,3,3,3-pentafluoropropylamino)pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(SC)nc1NCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H12F5N3O2S/c1-3-21-8(20)6-4-17-9(22-2)19-7(6)18-5-10(12,13)11(14,15)16/h4H,3,5H2,1-2H3,(H,17,18,19) |
| InChIKey | PYUFKYSJLRGFIP-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.29 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|