About piperazin-1-ylmethyl 2-phenylpropanoate
piperazin-1-ylmethyl 2-phenylpropanoate (PubChem CID 90094069) has the molecular formula C14H20N2O2
and a molecular weight of 248.33 g/mol. Its IUPAC name is piperazin-1-ylmethyl 2-phenylpropanoate.
Molecular Properties
| Compound Name | piperazin-1-ylmethyl 2-phenylpropanoate |
| PubChem CID | 90094069 |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | piperazin-1-ylmethyl 2-phenylpropanoate |
| SMILES | CC(C(=O)OCN1CCNCC1)c1ccccc1 |
| InChI | InChI=1S/C14H20N2O2/c1-12(13-5-3-2-4-6-13)14(17)18-11-16-9-7-15-8-10-16/h2-6,12,15H,7-11H2,1H3 |
| InChIKey | KFQGOAUHVFERPW-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze piperazin-1-ylmethyl 2-phenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperazin-1-ylmethyl 2-phenylpropanoate?
The IUPAC name of piperazin-1-ylmethyl 2-phenylpropanoate (CID 90094069) is piperazin-1-ylmethyl 2-phenylpropanoate.
What is the SMILES notation for piperazin-1-ylmethyl 2-phenylpropanoate?
The canonical SMILES for piperazin-1-ylmethyl 2-phenylpropanoate is CC(C(=O)OCN1CCNCC1)c1ccccc1.
What is the InChIKey of piperazin-1-ylmethyl 2-phenylpropanoate?
The InChIKey is KFQGOAUHVFERPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2O2/c1-12(13-5-3-2-4-6-13)14(17)18-11-16-9-7-15-8-10-16/h2-6,12,15H,7-11H2,1H3.
What are the key properties of piperazin-1-ylmethyl 2-phenylpropanoate?
piperazin-1-ylmethyl 2-phenylpropanoate has a molecular weight of 248.33 g/mol, XLogP of 1.20, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for piperazin-1-ylmethyl 2-phenylpropanoate is sourced from PubChem (CID 90094069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).