About 2-[6-[2-(3-chloro-4-fluorophenyl)-3-pyridinyl]quinazolin-4-yl]oxy-N,N-dimethylethanamine
2-[6-[2-(3-chloro-4-fluorophenyl)-3-pyridinyl]quinazolin-4-yl]oxy-N,N-dimethylethanamine (PubChem CID 90094084) has the molecular formula C23H20ClFN4O
and a molecular weight of 422.89 g/mol. Its IUPAC name is 2-[6-[2-(3-chloro-4-fluorophenyl)-3-pyridinyl]quinazolin-4-yl]oxy-N,N-dimethylethanamine.
Molecular Properties
| Compound Name | 2-[6-[2-(3-chloro-4-fluorophenyl)-3-pyridinyl]quinazolin-4-yl]oxy-N,N-dimethylethanamine |
| PubChem CID | 90094084 |
| Molecular Formula | C23H20ClFN4O |
| Molecular Weight | 422.89 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | 2-[6-[2-(3-chloro-4-fluorophenyl)-3-pyridinyl]quinazolin-4-yl]oxy-N,N-dimethylethanamine |
| SMILES | CN(C)CCOc1ncnc2ccc(-c3cccnc3-c3ccc(F)c(Cl)c3)cc12 |
| InChI | InChI=1S/C23H20ClFN4O/c1-29(2)10-11-30-23-18-12-15(6-8-21(18)27-14-28-23)17-4-3-9-26-22(17)16-5-7-20(25)19(24)13-16/h3-9,12-14H,10-11H2,1-2H3 |
| InChIKey | CRIAKVOFQKKCIO-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 422.89 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[6-[2-(3-chloro-4-fluorophenyl)-3-pyridinyl]quinazolin-4-yl]oxy-N,N-dimethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[6-[2-(3-chloro-4-fluorophenyl)-3-pyridinyl]quinazolin-4-yl]oxy-N,N-dimethylethanamine?
The IUPAC name of 2-[6-[2-(3-chloro-4-fluorophenyl)-3-pyridinyl]quinazolin-4-yl]oxy-N,N-dimethylethanamine (CID 90094084) is 2-[6-[2-(3-chloro-4-fluorophenyl)-3-pyridinyl]quinazolin-4-yl]oxy-N,N-dimethylethanamine.
What is the SMILES notation for 2-[6-[2-(3-chloro-4-fluorophenyl)-3-pyridinyl]quinazolin-4-yl]oxy-N,N-dimethylethanamine?
The canonical SMILES for 2-[6-[2-(3-chloro-4-fluorophenyl)-3-pyridinyl]quinazolin-4-yl]oxy-N,N-dimethylethanamine is CN(C)CCOc1ncnc2ccc(-c3cccnc3-c3ccc(F)c(Cl)c3)cc12.
What is the InChIKey of 2-[6-[2-(3-chloro-4-fluorophenyl)-3-pyridinyl]quinazolin-4-yl]oxy-N,N-dimethylethanamine?
The InChIKey is CRIAKVOFQKKCIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H20ClFN4O/c1-29(2)10-11-30-23-18-12-15(6-8-21(18)27-14-28-23)17-4-3-9-26-22(17)16-5-7-20(25)19(24)13-16/h3-9,12-14H,10-11H2,1-2H3.
What are the key properties of 2-[6-[2-(3-chloro-4-fluorophenyl)-3-pyridinyl]quinazolin-4-yl]oxy-N,N-dimethylethanamine?
2-[6-[2-(3-chloro-4-fluorophenyl)-3-pyridinyl]quinazolin-4-yl]oxy-N,N-dimethylethanamine has a molecular weight of 422.89 g/mol, XLogP of 5.09, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[6-[2-(3-chloro-4-fluorophenyl)-3-pyridinyl]quinazolin-4-yl]oxy-N,N-dimethylethanamine is sourced from PubChem (CID 90094084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).