About dimethyl (Z)-2-bis(2,4,6-trimethylbenzoyl)phosphanylbut-2-enedioate
dimethyl (Z)-2-bis(2,4,6-trimethylbenzoyl)phosphanylbut-2-enedioate (PubChem CID 90094722) has the molecular formula C26H29O6P
and a molecular weight of 468.49 g/mol. Its IUPAC name is dimethyl (Z)-2-bis(2,4,6-trimethylbenzoyl)phosphanylbut-2-enedioate.
Molecular Properties
| Compound Name | dimethyl (Z)-2-bis(2,4,6-trimethylbenzoyl)phosphanylbut-2-enedioate |
| PubChem CID | 90094722 |
| Molecular Formula | C26H29O6P |
| Molecular Weight | 468.49 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | dimethyl (Z)-2-bis(2,4,6-trimethylbenzoyl)phosphanylbut-2-enedioate |
| SMILES | COC(=O)/C=C(/C(=O)OC)P(C(=O)c1c(C)cc(C)cc1C)C(=O)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C26H29O6P/c1-14-9-16(3)22(17(4)10-14)25(29)33(20(24(28)32-8)13-21(27)31-7)26(30)23-18(5)11-15(2)12-19(23)6/h9-13H,1-8H3/b20-13- |
| InChIKey | IIVLVTLKGJRSHV-MOSHPQCFSA-N |
| XLogP | 5.23 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 468.49 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dimethyl (Z)-2-bis(2,4,6-trimethylbenzoyl)phosphanylbut-2-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl (Z)-2-bis(2,4,6-trimethylbenzoyl)phosphanylbut-2-enedioate?
The IUPAC name of dimethyl (Z)-2-bis(2,4,6-trimethylbenzoyl)phosphanylbut-2-enedioate (CID 90094722) is dimethyl (Z)-2-bis(2,4,6-trimethylbenzoyl)phosphanylbut-2-enedioate.
What is the SMILES notation for dimethyl (Z)-2-bis(2,4,6-trimethylbenzoyl)phosphanylbut-2-enedioate?
The canonical SMILES for dimethyl (Z)-2-bis(2,4,6-trimethylbenzoyl)phosphanylbut-2-enedioate is COC(=O)/C=C(/C(=O)OC)P(C(=O)c1c(C)cc(C)cc1C)C(=O)c1c(C)cc(C)cc1C.
What is the InChIKey of dimethyl (Z)-2-bis(2,4,6-trimethylbenzoyl)phosphanylbut-2-enedioate?
The InChIKey is IIVLVTLKGJRSHV-MOSHPQCFSA-N. The full InChI is InChI=1S/C26H29O6P/c1-14-9-16(3)22(17(4)10-14)25(29)33(20(24(28)32-8)13-21(27)31-7)26(30)23-18(5)11-15(2)12-19(23)6/h9-13H,1-8H3/b20-13-.
What are the key properties of dimethyl (Z)-2-bis(2,4,6-trimethylbenzoyl)phosphanylbut-2-enedioate?
dimethyl (Z)-2-bis(2,4,6-trimethylbenzoyl)phosphanylbut-2-enedioate has a molecular weight of 468.49 g/mol, XLogP of 5.23, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl (Z)-2-bis(2,4,6-trimethylbenzoyl)phosphanylbut-2-enedioate is sourced from PubChem (CID 90094722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).