About 4-methylsulfanyl-2-(3,3,3-trifluoropropylamino)benzoic acid
4-methylsulfanyl-2-(3,3,3-trifluoropropylamino)benzoic acid (PubChem CID 90095013) has the molecular formula C11H12F3NO2S
and a molecular weight of 279.28 g/mol. Its IUPAC name is 4-methylsulfanyl-2-(3,3,3-trifluoropropylamino)benzoic acid.
Molecular Properties
| Compound Name | 4-methylsulfanyl-2-(3,3,3-trifluoropropylamino)benzoic acid |
| PubChem CID | 90095013 |
| Molecular Formula | C11H12F3NO2S |
| Molecular Weight | 279.28 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | 4-methylsulfanyl-2-(3,3,3-trifluoropropylamino)benzoic acid |
| SMILES | CSc1ccc(C(=O)O)c(NCCC(F)(F)F)c1 |
| InChI | InChI=1S/C11H12F3NO2S/c1-18-7-2-3-8(10(16)17)9(6-7)15-5-4-11(12,13)14/h2-3,6,15H,4-5H2,1H3,(H,16,17) |
| InChIKey | ZEISLWIFJVNGNH-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.28 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methylsulfanyl-2-(3,3,3-trifluoropropylamino)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylsulfanyl-2-(3,3,3-trifluoropropylamino)benzoic acid?
The IUPAC name of 4-methylsulfanyl-2-(3,3,3-trifluoropropylamino)benzoic acid (CID 90095013) is 4-methylsulfanyl-2-(3,3,3-trifluoropropylamino)benzoic acid.
What is the SMILES notation for 4-methylsulfanyl-2-(3,3,3-trifluoropropylamino)benzoic acid?
The canonical SMILES for 4-methylsulfanyl-2-(3,3,3-trifluoropropylamino)benzoic acid is CSc1ccc(C(=O)O)c(NCCC(F)(F)F)c1.
What is the InChIKey of 4-methylsulfanyl-2-(3,3,3-trifluoropropylamino)benzoic acid?
The InChIKey is ZEISLWIFJVNGNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12F3NO2S/c1-18-7-2-3-8(10(16)17)9(6-7)15-5-4-11(12,13)14/h2-3,6,15H,4-5H2,1H3,(H,16,17).
What are the key properties of 4-methylsulfanyl-2-(3,3,3-trifluoropropylamino)benzoic acid?
4-methylsulfanyl-2-(3,3,3-trifluoropropylamino)benzoic acid has a molecular weight of 279.28 g/mol, XLogP of 3.47, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylsulfanyl-2-(3,3,3-trifluoropropylamino)benzoic acid is sourced from PubChem (CID 90095013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).