About N-[2-(2,6-difluorophenyl)-3,4-dihydropyrazol-5-yl]acetamide
N-[2-(2,6-difluorophenyl)-3,4-dihydropyrazol-5-yl]acetamide (PubChem CID 90095328) has the molecular formula C11H11F2N3O
and a molecular weight of 239.23 g/mol. Its IUPAC name is N-[2-(2,6-difluorophenyl)-3,4-dihydropyrazol-5-yl]acetamide.
Molecular Properties
| Compound Name | N-[2-(2,6-difluorophenyl)-3,4-dihydropyrazol-5-yl]acetamide |
| PubChem CID | 90095328 |
| Molecular Formula | C11H11F2N3O |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | N-[2-(2,6-difluorophenyl)-3,4-dihydropyrazol-5-yl]acetamide |
| SMILES | CC(=O)NC1=NN(c2c(F)cccc2F)CC1 |
| InChI | InChI=1S/C11H11F2N3O/c1-7(17)14-10-5-6-16(15-10)11-8(12)3-2-4-9(11)13/h2-4H,5-6H2,1H3,(H,14,15,17) |
| InChIKey | KSBFIHXOYGXXRR-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[2-(2,6-difluorophenyl)-3,4-dihydropyrazol-5-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(2,6-difluorophenyl)-3,4-dihydropyrazol-5-yl]acetamide?
The IUPAC name of N-[2-(2,6-difluorophenyl)-3,4-dihydropyrazol-5-yl]acetamide (CID 90095328) is N-[2-(2,6-difluorophenyl)-3,4-dihydropyrazol-5-yl]acetamide.
What is the SMILES notation for N-[2-(2,6-difluorophenyl)-3,4-dihydropyrazol-5-yl]acetamide?
The canonical SMILES for N-[2-(2,6-difluorophenyl)-3,4-dihydropyrazol-5-yl]acetamide is CC(=O)NC1=NN(c2c(F)cccc2F)CC1.
What is the InChIKey of N-[2-(2,6-difluorophenyl)-3,4-dihydropyrazol-5-yl]acetamide?
The InChIKey is KSBFIHXOYGXXRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11F2N3O/c1-7(17)14-10-5-6-16(15-10)11-8(12)3-2-4-9(11)13/h2-4H,5-6H2,1H3,(H,14,15,17).
What are the key properties of N-[2-(2,6-difluorophenyl)-3,4-dihydropyrazol-5-yl]acetamide?
N-[2-(2,6-difluorophenyl)-3,4-dihydropyrazol-5-yl]acetamide has a molecular weight of 239.23 g/mol, XLogP of 1.62, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(2,6-difluorophenyl)-3,4-dihydropyrazol-5-yl]acetamide is sourced from PubChem (CID 90095328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).