About 2-methylsulfanyl-4,5-diphenyl-1H-imidazole
2-methylsulfanyl-4,5-diphenyl-1H-imidazole (PubChem CID 900954) has the molecular formula C16H14N2S
and a molecular weight of 266.37 g/mol. Its IUPAC name is 2-methylsulfanyl-4,5-diphenyl-1H-imidazole.
Molecular Properties
| Compound Name | 2-methylsulfanyl-4,5-diphenyl-1H-imidazole |
| PubChem CID | 900954 |
| Molecular Formula | C16H14N2S |
| Molecular Weight | 266.37 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 2-methylsulfanyl-4,5-diphenyl-1H-imidazole |
| SMILES | CSc1nc(-c2ccccc2)c(-c2ccccc2)[nH]1 |
| InChI | InChI=1S/C16H14N2S/c1-19-16-17-14(12-8-4-2-5-9-12)15(18-16)13-10-6-3-7-11-13/h2-11H,1H3,(H,17,18) |
| InChIKey | FKYCCFMGPGRPID-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.37 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methylsulfanyl-4,5-diphenyl-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylsulfanyl-4,5-diphenyl-1H-imidazole?
The IUPAC name of 2-methylsulfanyl-4,5-diphenyl-1H-imidazole (CID 900954) is 2-methylsulfanyl-4,5-diphenyl-1H-imidazole.
What is the SMILES notation for 2-methylsulfanyl-4,5-diphenyl-1H-imidazole?
The canonical SMILES for 2-methylsulfanyl-4,5-diphenyl-1H-imidazole is CSc1nc(-c2ccccc2)c(-c2ccccc2)[nH]1.
What is the InChIKey of 2-methylsulfanyl-4,5-diphenyl-1H-imidazole?
The InChIKey is FKYCCFMGPGRPID-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N2S/c1-19-16-17-14(12-8-4-2-5-9-12)15(18-16)13-10-6-3-7-11-13/h2-11H,1H3,(H,17,18).
What are the key properties of 2-methylsulfanyl-4,5-diphenyl-1H-imidazole?
2-methylsulfanyl-4,5-diphenyl-1H-imidazole has a molecular weight of 266.37 g/mol, XLogP of 4.47, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylsulfanyl-4,5-diphenyl-1H-imidazole is sourced from PubChem (CID 900954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).