About 6-[2-(1,3-benzodioxol-5-yl)-3-pyridinyl]-1,3-benzothiazole
6-[2-(1,3-benzodioxol-5-yl)-3-pyridinyl]-1,3-benzothiazole (PubChem CID 90095974) has the molecular formula C19H12N2O2S
and a molecular weight of 332.38 g/mol. Its IUPAC name is 6-[2-(1,3-benzodioxol-5-yl)-3-pyridinyl]-1,3-benzothiazole.
Molecular Properties
| Compound Name | 6-[2-(1,3-benzodioxol-5-yl)-3-pyridinyl]-1,3-benzothiazole |
| PubChem CID | 90095974 |
| Molecular Formula | C19H12N2O2S |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | 6-[2-(1,3-benzodioxol-5-yl)-3-pyridinyl]-1,3-benzothiazole |
| SMILES | c1cnc(-c2ccc3c(c2)OCO3)c(-c2ccc3ncsc3c2)c1 |
| InChI | InChI=1S/C19H12N2O2S/c1-2-14(12-3-5-15-18(9-12)24-10-21-15)19(20-7-1)13-4-6-16-17(8-13)23-11-22-16/h1-10H,11H2 |
| InChIKey | VQRWNJBKKGAQHJ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-[2-(1,3-benzodioxol-5-yl)-3-pyridinyl]-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[2-(1,3-benzodioxol-5-yl)-3-pyridinyl]-1,3-benzothiazole?
The IUPAC name of 6-[2-(1,3-benzodioxol-5-yl)-3-pyridinyl]-1,3-benzothiazole (CID 90095974) is 6-[2-(1,3-benzodioxol-5-yl)-3-pyridinyl]-1,3-benzothiazole.
What is the SMILES notation for 6-[2-(1,3-benzodioxol-5-yl)-3-pyridinyl]-1,3-benzothiazole?
The canonical SMILES for 6-[2-(1,3-benzodioxol-5-yl)-3-pyridinyl]-1,3-benzothiazole is c1cnc(-c2ccc3c(c2)OCO3)c(-c2ccc3ncsc3c2)c1.
What is the InChIKey of 6-[2-(1,3-benzodioxol-5-yl)-3-pyridinyl]-1,3-benzothiazole?
The InChIKey is VQRWNJBKKGAQHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H12N2O2S/c1-2-14(12-3-5-15-18(9-12)24-10-21-15)19(20-7-1)13-4-6-16-17(8-13)23-11-22-16/h1-10H,11H2.
What are the key properties of 6-[2-(1,3-benzodioxol-5-yl)-3-pyridinyl]-1,3-benzothiazole?
6-[2-(1,3-benzodioxol-5-yl)-3-pyridinyl]-1,3-benzothiazole has a molecular weight of 332.38 g/mol, XLogP of 4.75, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[2-(1,3-benzodioxol-5-yl)-3-pyridinyl]-1,3-benzothiazole is sourced from PubChem (CID 90095974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).