C25H26N6O7S — CID 90096102
methanesulfonate;[3-(methylcarbamoyl)pyridin-1-ium-1-yl]methyl 2-cyclopropyl-7-methyl-10-oxo-2,4,9,15-tetrazatricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,12,14-hexaene-9-carboxylate (PubChem CID 90096102) has the molecular formula C25H26N6O7S and a molecular weight of 554.59 g/mol. Its IUPAC name is methanesulfonate;[3-(methylcarbamoyl)pyridin-1-ium-1-yl]methyl 2-cyclopropyl-7-methyl-10-oxo-2,4,9,15-tetrazatricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,12,14-hexaene-9-carboxylate.
| Compound Name | methanesulfonate;[3-(methylcarbamoyl)pyridin-1-ium-1-yl]methyl 2-cyclopropyl-7-methyl-10-oxo-2,4,9,15-tetrazatricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,12,14-hexaene-9-carboxylate |
|---|---|
| PubChem CID | 90096102 |
| Molecular Formula | C25H26N6O7S |
| Molecular Weight | 554.59 g/mol |
| Exact Mass | 554.16 |
| IUPAC Name | methanesulfonate;[3-(methylcarbamoyl)pyridin-1-ium-1-yl]methyl 2-cyclopropyl-7-methyl-10-oxo-2,4,9,15-tetrazatricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,12,14-hexaene-9-carboxylate |
| SMILES | CNC(=O)c1ccc[n+](COC(=O)N2C(=O)c3cccnc3N(C3CC3)c3nccc(C)c32)c1.CS(=O)(=O)[O-] |
| InChI | InChI=1S/C24H22N6O4.CH4O3S/c1-15-9-11-27-21-19(15)30(23(32)18-6-3-10-26-20(18)29(21)17-7-8-17)24(33)34-14-28-12-4-5-16(13-28)22(31)25-2;1-5(2,3)4/h3-6,9-13,17H,7-8,14H2,1-2H3;1H3,(H,2,3,4) |
| InChIKey | STYJWYQLVBKJLW-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 165.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.59 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|