C18H11ClF2N4O — CID 90096214
7-[2-(5-chloro-2,4-difluorophenyl)-5-methoxy-3-pyridinyl]-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 90096214) has the molecular formula C18H11ClF2N4O and a molecular weight of 372.76 g/mol. Its IUPAC name is 7-[2-(5-chloro-2,4-difluorophenyl)-5-methoxy-3-pyridinyl]-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 7-[2-(5-chloro-2,4-difluorophenyl)-5-methoxy-3-pyridinyl]-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 90096214 |
| Molecular Formula | C18H11ClF2N4O |
| Molecular Weight | 372.76 g/mol |
| Exact Mass | 372.06 |
| IUPAC Name | 7-[2-(5-chloro-2,4-difluorophenyl)-5-methoxy-3-pyridinyl]-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | COc1cnc(-c2cc(Cl)c(F)cc2F)c(-c2ccn3ncnc3c2)c1 |
| InChI | InChI=1S/C18H11ClF2N4O/c1-26-11-5-12(10-2-3-25-17(4-10)23-9-24-25)18(22-8-11)13-6-14(19)16(21)7-15(13)20/h2-9H,1H3 |
| InChIKey | GKIGYATUGWASIC-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 52.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.76 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|