C22H25Cl2FN4S — CID 90097120
N-[6-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-4-ylmethyl)-2-pyridinyl]-5-(4-fluorophenyl)-1,3-thiazol-2-amine;dihydrochloride (PubChem CID 90097120) has the molecular formula C22H25Cl2FN4S and a molecular weight of 467.44 g/mol. Its IUPAC name is N-[6-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-4-ylmethyl)-2-pyridinyl]-5-(4-fluorophenyl)-1,3-thiazol-2-amine;dihydrochloride.
| Compound Name | N-[6-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-4-ylmethyl)-2-pyridinyl]-5-(4-fluorophenyl)-1,3-thiazol-2-amine;dihydrochloride |
|---|---|
| PubChem CID | 90097120 |
| Molecular Formula | C22H25Cl2FN4S |
| Molecular Weight | 467.44 g/mol |
| Exact Mass | 466.12 |
| IUPAC Name | N-[6-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-4-ylmethyl)-2-pyridinyl]-5-(4-fluorophenyl)-1,3-thiazol-2-amine;dihydrochloride |
| SMILES | Cl.Cl.Fc1ccc(-c2cnc(Nc3cccc(CC4CCC5CNCC54)n3)s2)cc1 |
| InChI | InChI=1S/C22H23FN4S.2ClH/c23-17-8-6-14(7-9-17)20-13-25-22(28-20)27-21-3-1-2-18(26-21)10-15-4-5-16-11-24-12-19(15)16;;/h1-3,6-9,13,15-16,19,24H,4-5,10-12H2,(H,25,26,27);2*1H |
| InChIKey | XJMSZSGMXBCSET-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.44 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |