About 3-[(4-fluorophenyl)methyl]-8,8-dimethyl-7,9-dioxaspiro[4.5]decan-4-one
3-[(4-fluorophenyl)methyl]-8,8-dimethyl-7,9-dioxaspiro[4.5]decan-4-one (PubChem CID 90097218) has the molecular formula C17H21FO3
and a molecular weight of 292.35 g/mol. Its IUPAC name is 3-[(4-fluorophenyl)methyl]-8,8-dimethyl-7,9-dioxaspiro[4.5]decan-4-one.
Molecular Properties
| Compound Name | 3-[(4-fluorophenyl)methyl]-8,8-dimethyl-7,9-dioxaspiro[4.5]decan-4-one |
| PubChem CID | 90097218 |
| Molecular Formula | C17H21FO3 |
| Molecular Weight | 292.35 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 3-[(4-fluorophenyl)methyl]-8,8-dimethyl-7,9-dioxaspiro[4.5]decan-4-one |
| SMILES | CC1(C)OCC2(CCC(Cc3ccc(F)cc3)C2=O)CO1 |
| InChI | InChI=1S/C17H21FO3/c1-16(2)20-10-17(11-21-16)8-7-13(15(17)19)9-12-3-5-14(18)6-4-12/h3-6,13H,7-11H2,1-2H3 |
| InChIKey | JQHYOQGPGGCYMT-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.35 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(4-fluorophenyl)methyl]-8,8-dimethyl-7,9-dioxaspiro[4.5]decan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4-fluorophenyl)methyl]-8,8-dimethyl-7,9-dioxaspiro[4.5]decan-4-one?
The IUPAC name of 3-[(4-fluorophenyl)methyl]-8,8-dimethyl-7,9-dioxaspiro[4.5]decan-4-one (CID 90097218) is 3-[(4-fluorophenyl)methyl]-8,8-dimethyl-7,9-dioxaspiro[4.5]decan-4-one.
What is the SMILES notation for 3-[(4-fluorophenyl)methyl]-8,8-dimethyl-7,9-dioxaspiro[4.5]decan-4-one?
The canonical SMILES for 3-[(4-fluorophenyl)methyl]-8,8-dimethyl-7,9-dioxaspiro[4.5]decan-4-one is CC1(C)OCC2(CCC(Cc3ccc(F)cc3)C2=O)CO1.
What is the InChIKey of 3-[(4-fluorophenyl)methyl]-8,8-dimethyl-7,9-dioxaspiro[4.5]decan-4-one?
The InChIKey is JQHYOQGPGGCYMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21FO3/c1-16(2)20-10-17(11-21-16)8-7-13(15(17)19)9-12-3-5-14(18)6-4-12/h3-6,13H,7-11H2,1-2H3.
What are the key properties of 3-[(4-fluorophenyl)methyl]-8,8-dimethyl-7,9-dioxaspiro[4.5]decan-4-one?
3-[(4-fluorophenyl)methyl]-8,8-dimethyl-7,9-dioxaspiro[4.5]decan-4-one has a molecular weight of 292.35 g/mol, XLogP of 3.12, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4-fluorophenyl)methyl]-8,8-dimethyl-7,9-dioxaspiro[4.5]decan-4-one is sourced from PubChem (CID 90097218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).