C32H28ClF3N6O5S2 — CID 90097313
2-[4-[2-amino-6-[[2-(4-chlorophenyl)-1,3-thiazol-4-yl]methylsulfanyl]-3,5-dicyano-4-pyridinyl]phenoxy]ethyl (2S)-2-amino-3-methylbutanoate;2,2,2-trifluoroacetic acid (PubChem CID 90097313) has the molecular formula C32H28ClF3N6O5S2 and a molecular weight of 733.19 g/mol. Its IUPAC name is 2-[4-[2-amino-6-[[2-(4-chlorophenyl)-1,3-thiazol-4-yl]methylsulfanyl]-3,5-dicyano-4-pyridinyl]phenoxy]ethyl (2S)-2-amino-3-methylbutanoate;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[4-[2-amino-6-[[2-(4-chlorophenyl)-1,3-thiazol-4-yl]methylsulfanyl]-3,5-dicyano-4-pyridinyl]phenoxy]ethyl (2S)-2-amino-3-methylbutanoate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 90097313 |
| Molecular Formula | C32H28ClF3N6O5S2 |
| Molecular Weight | 733.19 g/mol |
| Exact Mass | 732.12 |
| IUPAC Name | 2-[4-[2-amino-6-[[2-(4-chlorophenyl)-1,3-thiazol-4-yl]methylsulfanyl]-3,5-dicyano-4-pyridinyl]phenoxy]ethyl (2S)-2-amino-3-methylbutanoate;2,2,2-trifluoroacetic acid |
| SMILES | CC(C)[C@H](N)C(=O)OCCOc1ccc(-c2c(C#N)c(N)nc(SCc3csc(-c4ccc(Cl)cc4)n3)c2C#N)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C30H27ClN6O3S2.C2HF3O2/c1-17(2)26(34)30(38)40-12-11-39-22-9-5-18(6-10-22)25-23(13-32)27(35)37-29(24(25)14-33)42-16-21-15-41-28(36-21)19-3-7-20(31)8-4-19;3-2(4,5)1(6)7/h3-10,15,17,26H,11-12,16,34H2,1-2H3,(H2,35,37);(H,6,7)/t26-;/m0./s1 |
| InChIKey | GEGJNUMPIONTOP-SNYZSRNZSA-N |
| XLogP | 6.68 |
| TPSA | 198.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.19 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|