C10H12N6O — CID 90097398
formamide;6-phenyl-1,3,5-triazine-2,4-diamine (PubChem CID 90097398) has the molecular formula C10H12N6O and a molecular weight of 232.25 g/mol. Its IUPAC name is formamide;6-phenyl-1,3,5-triazine-2,4-diamine.
| Compound Name | formamide;6-phenyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 90097398 |
| Molecular Formula | C10H12N6O |
| Molecular Weight | 232.25 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | formamide;6-phenyl-1,3,5-triazine-2,4-diamine |
| SMILES | NC=O.Nc1nc(N)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C9H9N5.CH3NO/c10-8-12-7(13-9(11)14-8)6-4-2-1-3-5-6;2-1-3/h1-5H,(H4,10,11,12,13,14);1H,(H2,2,3) |
| InChIKey | DWKIRCRQRQJCQU-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 133.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.25 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|