About 1-(ethylamino)-4b,9b-dihydroxy-7-propan-2-ylindeno[1,2-b][1]benzofuran-10-one
1-(ethylamino)-4b,9b-dihydroxy-7-propan-2-ylindeno[1,2-b][1]benzofuran-10-one (PubChem CID 90097669) has the molecular formula C20H21NO4
and a molecular weight of 339.39 g/mol. Its IUPAC name is 1-(ethylamino)-4b,9b-dihydroxy-7-propan-2-ylindeno[1,2-b][1]benzofuran-10-one.
Molecular Properties
| Compound Name | 1-(ethylamino)-4b,9b-dihydroxy-7-propan-2-ylindeno[1,2-b][1]benzofuran-10-one |
| PubChem CID | 90097669 |
| Molecular Formula | C20H21NO4 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | 1-(ethylamino)-4b,9b-dihydroxy-7-propan-2-ylindeno[1,2-b][1]benzofuran-10-one |
| SMILES | CCNc1cccc2c1C(=O)C1(O)c3ccc(C(C)C)cc3OC21O |
| InChI | InChI=1S/C20H21NO4/c1-4-21-15-7-5-6-14-17(15)18(22)19(23)13-9-8-12(11(2)3)10-16(13)25-20(14,19)24/h5-11,21,23-24H,4H2,1-3H3 |
| InChIKey | POAHBBULVBJONO-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(ethylamino)-4b,9b-dihydroxy-7-propan-2-ylindeno[1,2-b][1]benzofuran-10-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(ethylamino)-4b,9b-dihydroxy-7-propan-2-ylindeno[1,2-b][1]benzofuran-10-one?
The IUPAC name of 1-(ethylamino)-4b,9b-dihydroxy-7-propan-2-ylindeno[1,2-b][1]benzofuran-10-one (CID 90097669) is 1-(ethylamino)-4b,9b-dihydroxy-7-propan-2-ylindeno[1,2-b][1]benzofuran-10-one.
What is the SMILES notation for 1-(ethylamino)-4b,9b-dihydroxy-7-propan-2-ylindeno[1,2-b][1]benzofuran-10-one?
The canonical SMILES for 1-(ethylamino)-4b,9b-dihydroxy-7-propan-2-ylindeno[1,2-b][1]benzofuran-10-one is CCNc1cccc2c1C(=O)C1(O)c3ccc(C(C)C)cc3OC21O.
What is the InChIKey of 1-(ethylamino)-4b,9b-dihydroxy-7-propan-2-ylindeno[1,2-b][1]benzofuran-10-one?
The InChIKey is POAHBBULVBJONO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21NO4/c1-4-21-15-7-5-6-14-17(15)18(22)19(23)13-9-8-12(11(2)3)10-16(13)25-20(14,19)24/h5-11,21,23-24H,4H2,1-3H3.
What are the key properties of 1-(ethylamino)-4b,9b-dihydroxy-7-propan-2-ylindeno[1,2-b][1]benzofuran-10-one?
1-(ethylamino)-4b,9b-dihydroxy-7-propan-2-ylindeno[1,2-b][1]benzofuran-10-one has a molecular weight of 339.39 g/mol, XLogP of 2.86, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(ethylamino)-4b,9b-dihydroxy-7-propan-2-ylindeno[1,2-b][1]benzofuran-10-one is sourced from PubChem (CID 90097669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).