C31H24ClFN2O6 — CID 90097785
N-(4b-hydroxy-1-nitro-10-oxo-7-propan-2-ylindeno[1,2-b][1]benzofuran-9b-yl)-5-(2-chloro-6-fluorophenyl)-2-methylcyclopenta-1,4-diene-1-carboxamide (PubChem CID 90097785) has the molecular formula C31H24ClFN2O6 and a molecular weight of 574.99 g/mol. Its IUPAC name is N-(4b-hydroxy-1-nitro-10-oxo-7-propan-2-ylindeno[1,2-b][1]benzofuran-9b-yl)-5-(2-chloro-6-fluorophenyl)-2-methylcyclopenta-1,4-diene-1-carboxamide.
| Compound Name | N-(4b-hydroxy-1-nitro-10-oxo-7-propan-2-ylindeno[1,2-b][1]benzofuran-9b-yl)-5-(2-chloro-6-fluorophenyl)-2-methylcyclopenta-1,4-diene-1-carboxamide |
|---|---|
| PubChem CID | 90097785 |
| Molecular Formula | C31H24ClFN2O6 |
| Molecular Weight | 574.99 g/mol |
| Exact Mass | 574.13 |
| IUPAC Name | N-(4b-hydroxy-1-nitro-10-oxo-7-propan-2-ylindeno[1,2-b][1]benzofuran-9b-yl)-5-(2-chloro-6-fluorophenyl)-2-methylcyclopenta-1,4-diene-1-carboxamide |
| SMILES | CC1=C(C(=O)NC23C(=O)c4c([N+](=O)[O-])cccc4C2(O)Oc2cc(C(C)C)ccc23)C(c2c(F)cccc2Cl)=CC1 |
| InChI | InChI=1S/C31H24ClFN2O6/c1-15(2)17-11-13-19-24(14-17)41-31(38)20-6-4-9-23(35(39)40)27(20)28(36)30(19,31)34-29(37)25-16(3)10-12-18(25)26-21(32)7-5-8-22(26)33/h4-9,11-15,38H,10H2,1-3H3,(H,34,37) |
| InChIKey | GKSNAYQEMAYMQJ-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.99 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|