C23H27N5O5S — CID 90097920
N-[5-hydroxy-6-oxo-4-[(6-sulfanylidenecyclohexa-1,3-dien-1-yl)methylcarbamoyl]-3,7-diazatricyclo[7.2.2.02,7]trideca-2,4-dien-1-yl]-N',N'-dimethyloxamide (PubChem CID 90097920) has the molecular formula C23H27N5O5S and a molecular weight of 485.57 g/mol. Its IUPAC name is N-[5-hydroxy-6-oxo-4-[(6-sulfanylidenecyclohexa-1,3-dien-1-yl)methylcarbamoyl]-3,7-diazatricyclo[7.2.2.02,7]trideca-2,4-dien-1-yl]-N',N'-dimethyloxamide.
| Compound Name | N-[5-hydroxy-6-oxo-4-[(6-sulfanylidenecyclohexa-1,3-dien-1-yl)methylcarbamoyl]-3,7-diazatricyclo[7.2.2.02,7]trideca-2,4-dien-1-yl]-N',N'-dimethyloxamide |
|---|---|
| PubChem CID | 90097920 |
| Molecular Formula | C23H27N5O5S |
| Molecular Weight | 485.57 g/mol |
| Exact Mass | 485.17 |
| IUPAC Name | N-[5-hydroxy-6-oxo-4-[(6-sulfanylidenecyclohexa-1,3-dien-1-yl)methylcarbamoyl]-3,7-diazatricyclo[7.2.2.02,7]trideca-2,4-dien-1-yl]-N',N'-dimethyloxamide |
| SMILES | CN(C)C(=O)C(=O)NC12CCC(CC1)Cn1c2nc(C(=O)NCC2=CC=CCC2=S)c(O)c1=O |
| InChI | InChI=1S/C23H27N5O5S/c1-27(2)21(33)19(31)26-23-9-7-13(8-10-23)12-28-20(32)17(29)16(25-22(23)28)18(30)24-11-14-5-3-4-6-15(14)34/h3-5,13,29H,6-12H2,1-2H3,(H,24,30)(H,26,31) |
| InChIKey | AZTJIGVSWXHKJZ-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 133.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.57 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|