About [(3R,4R)-4-[(5-bromo-6-cyano-3-pyridinyl)amino]oxan-3-yl]carbamic acid
[(3R,4R)-4-[(5-bromo-6-cyano-3-pyridinyl)amino]oxan-3-yl]carbamic acid (PubChem CID 90098279) has the molecular formula C12H13BrN4O3
and a molecular weight of 341.17 g/mol. Its IUPAC name is [(3R,4R)-4-[(5-bromo-6-cyano-3-pyridinyl)amino]oxan-3-yl]carbamic acid.
Molecular Properties
| Compound Name | [(3R,4R)-4-[(5-bromo-6-cyano-3-pyridinyl)amino]oxan-3-yl]carbamic acid |
| PubChem CID | 90098279 |
| Molecular Formula | C12H13BrN4O3 |
| Molecular Weight | 341.17 g/mol |
| Exact Mass | 340.02 |
| IUPAC Name | [(3R,4R)-4-[(5-bromo-6-cyano-3-pyridinyl)amino]oxan-3-yl]carbamic acid |
| SMILES | N#Cc1ncc(N[C@@H]2CCOC[C@@H]2NC(=O)O)cc1Br |
| InChI | InChI=1S/C12H13BrN4O3/c13-8-3-7(5-15-10(8)4-14)16-9-1-2-20-6-11(9)17-12(18)19/h3,5,9,11,16-17H,1-2,6H2,(H,18,19)/t9-,11+/m1/s1 |
| InChIKey | OBWORVIHXXPHCY-KOLCDFICSA-N |
| XLogP | 1.55 |
| TPSA | 107.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.17 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(3R,4R)-4-[(5-bromo-6-cyano-3-pyridinyl)amino]oxan-3-yl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R,4R)-4-[(5-bromo-6-cyano-3-pyridinyl)amino]oxan-3-yl]carbamic acid?
The IUPAC name of [(3R,4R)-4-[(5-bromo-6-cyano-3-pyridinyl)amino]oxan-3-yl]carbamic acid (CID 90098279) is [(3R,4R)-4-[(5-bromo-6-cyano-3-pyridinyl)amino]oxan-3-yl]carbamic acid.
What is the SMILES notation for [(3R,4R)-4-[(5-bromo-6-cyano-3-pyridinyl)amino]oxan-3-yl]carbamic acid?
The canonical SMILES for [(3R,4R)-4-[(5-bromo-6-cyano-3-pyridinyl)amino]oxan-3-yl]carbamic acid is N#Cc1ncc(N[C@@H]2CCOC[C@@H]2NC(=O)O)cc1Br.
What is the InChIKey of [(3R,4R)-4-[(5-bromo-6-cyano-3-pyridinyl)amino]oxan-3-yl]carbamic acid?
The InChIKey is OBWORVIHXXPHCY-KOLCDFICSA-N. The full InChI is InChI=1S/C12H13BrN4O3/c13-8-3-7(5-15-10(8)4-14)16-9-1-2-20-6-11(9)17-12(18)19/h3,5,9,11,16-17H,1-2,6H2,(H,18,19)/t9-,11+/m1/s1.
What are the key properties of [(3R,4R)-4-[(5-bromo-6-cyano-3-pyridinyl)amino]oxan-3-yl]carbamic acid?
[(3R,4R)-4-[(5-bromo-6-cyano-3-pyridinyl)amino]oxan-3-yl]carbamic acid has a molecular weight of 341.17 g/mol, XLogP of 1.55, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R,4R)-4-[(5-bromo-6-cyano-3-pyridinyl)amino]oxan-3-yl]carbamic acid is sourced from PubChem (CID 90098279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).