C11H11F3N4O4S — CID 90098428
(1R,2S,4S,5R,6R)-2-amino-4-[[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]sulfanyl]bicyclo[3.1.0]hexane-2,6-dicarboxylic acid (PubChem CID 90098428) has the molecular formula C11H11F3N4O4S and a molecular weight of 352.29 g/mol. Its IUPAC name is (1R,2S,4S,5R,6R)-2-amino-4-[[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]sulfanyl]bicyclo[3.1.0]hexane-2,6-dicarboxylic acid.
| Compound Name | (1R,2S,4S,5R,6R)-2-amino-4-[[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]sulfanyl]bicyclo[3.1.0]hexane-2,6-dicarboxylic acid |
|---|---|
| PubChem CID | 90098428 |
| Molecular Formula | C11H11F3N4O4S |
| Molecular Weight | 352.29 g/mol |
| Exact Mass | 352.05 |
| IUPAC Name | (1R,2S,4S,5R,6R)-2-amino-4-[[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]sulfanyl]bicyclo[3.1.0]hexane-2,6-dicarboxylic acid |
| SMILES | N[C@@]1(C(=O)O)C[C@H](Sc2n[nH]c(C(F)(F)F)n2)[C@H]2[C@H](C(=O)O)[C@H]21 |
| InChI | InChI=1S/C11H11F3N4O4S/c12-11(13,14)7-16-9(18-17-7)23-2-1-10(15,8(21)22)5-3(2)4(5)6(19)20/h2-5H,1,15H2,(H,19,20)(H,21,22)(H,16,17,18)/t2-,3-,4-,5-,10-/m0/s1 |
| InChIKey | HHUBIRLCPJRLDB-CWOZVJDESA-N |
| XLogP | 0.42 |
| TPSA | 142.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.29 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |