About 2-chloro-5-(chloromethyl)pyridine;pyridine
2-chloro-5-(chloromethyl)pyridine;pyridine (PubChem CID 90098666) has the molecular formula C11H10Cl2N2
and a molecular weight of 241.12 g/mol. Its IUPAC name is 2-chloro-5-(chloromethyl)pyridine;pyridine.
Molecular Properties
| Compound Name | 2-chloro-5-(chloromethyl)pyridine;pyridine |
| PubChem CID | 90098666 |
| Molecular Formula | C11H10Cl2N2 |
| Molecular Weight | 241.12 g/mol |
| Exact Mass | 240.02 |
| IUPAC Name | 2-chloro-5-(chloromethyl)pyridine;pyridine |
| SMILES | ClCc1ccc(Cl)nc1.c1ccncc1 |
| InChI | InChI=1S/C6H5Cl2N.C5H5N/c7-3-5-1-2-6(8)9-4-5;1-2-4-6-5-3-1/h1-2,4H,3H2;1-5H |
| InChIKey | JCZOPBHVGNJKKX-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.12 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-5-(chloromethyl)pyridine;pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-5-(chloromethyl)pyridine;pyridine?
The IUPAC name of 2-chloro-5-(chloromethyl)pyridine;pyridine (CID 90098666) is 2-chloro-5-(chloromethyl)pyridine;pyridine.
What is the SMILES notation for 2-chloro-5-(chloromethyl)pyridine;pyridine?
The canonical SMILES for 2-chloro-5-(chloromethyl)pyridine;pyridine is ClCc1ccc(Cl)nc1.c1ccncc1.
What is the InChIKey of 2-chloro-5-(chloromethyl)pyridine;pyridine?
The InChIKey is JCZOPBHVGNJKKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5Cl2N.C5H5N/c7-3-5-1-2-6(8)9-4-5;1-2-4-6-5-3-1/h1-2,4H,3H2;1-5H.
What are the key properties of 2-chloro-5-(chloromethyl)pyridine;pyridine?
2-chloro-5-(chloromethyl)pyridine;pyridine has a molecular weight of 241.12 g/mol, XLogP of 3.56, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-5-(chloromethyl)pyridine;pyridine is sourced from PubChem (CID 90098666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).