About dicyanoboranuide;tetraethylazanium
dicyanoboranuide;tetraethylazanium (PubChem CID 90098883) has the molecular formula C10H22BN3
and a molecular weight of 195.12 g/mol. Its IUPAC name is dicyanoboranuide;tetraethylazanium.
Molecular Properties
| Compound Name | dicyanoboranuide;tetraethylazanium |
| PubChem CID | 90098883 |
| Molecular Formula | C10H22BN3 |
| Molecular Weight | 195.12 g/mol |
| Exact Mass | 195.19 |
| IUPAC Name | dicyanoboranuide;tetraethylazanium |
| SMILES | CC[N+](CC)(CC)CC.N#C[BH2-]C#N |
| InChI | InChI=1S/C8H20N.C2H2BN2/c1-5-9(6-2,7-3)8-4;4-1-3-2-5/h5-8H2,1-4H3;3H2/q+1;-1 |
| InChIKey | GWAODBDETUCWCB-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.12 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze dicyanoboranuide;tetraethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dicyanoboranuide;tetraethylazanium?
The IUPAC name of dicyanoboranuide;tetraethylazanium (CID 90098883) is dicyanoboranuide;tetraethylazanium.
What is the SMILES notation for dicyanoboranuide;tetraethylazanium?
The canonical SMILES for dicyanoboranuide;tetraethylazanium is CC[N+](CC)(CC)CC.N#C[BH2-]C#N.
What is the InChIKey of dicyanoboranuide;tetraethylazanium?
The InChIKey is GWAODBDETUCWCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H20N.C2H2BN2/c1-5-9(6-2,7-3)8-4;4-1-3-2-5/h5-8H2,1-4H3;3H2/q+1;-1.
What are the key properties of dicyanoboranuide;tetraethylazanium?
dicyanoboranuide;tetraethylazanium has a molecular weight of 195.12 g/mol, XLogP of 1.00, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dicyanoboranuide;tetraethylazanium is sourced from PubChem (CID 90098883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).