C22H17ClF3N7 — CID 90098991
4-(5-chloro-4-piperazin-1-ylpyrido[3,4-d]pyrimidin-2-yl)-N-(2,3,6-trifluorophenyl)pyridin-2-amine (PubChem CID 90098991) has the molecular formula C22H17ClF3N7 and a molecular weight of 471.87 g/mol. Its IUPAC name is 4-(5-chloro-4-piperazin-1-ylpyrido[3,4-d]pyrimidin-2-yl)-N-(2,3,6-trifluorophenyl)pyridin-2-amine.
| Compound Name | 4-(5-chloro-4-piperazin-1-ylpyrido[3,4-d]pyrimidin-2-yl)-N-(2,3,6-trifluorophenyl)pyridin-2-amine |
|---|---|
| PubChem CID | 90098991 |
| Molecular Formula | C22H17ClF3N7 |
| Molecular Weight | 471.87 g/mol |
| Exact Mass | 471.12 |
| IUPAC Name | 4-(5-chloro-4-piperazin-1-ylpyrido[3,4-d]pyrimidin-2-yl)-N-(2,3,6-trifluorophenyl)pyridin-2-amine |
| SMILES | Fc1ccc(F)c(Nc2cc(-c3nc(N4CCNCC4)c4c(Cl)cncc4n3)ccn2)c1F |
| InChI | InChI=1S/C22H17ClF3N7/c23-13-10-28-11-16-18(13)22(33-7-5-27-6-8-33)32-21(30-16)12-3-4-29-17(9-12)31-20-15(25)2-1-14(24)19(20)26/h1-4,9-11,27H,5-8H2,(H,29,31) |
| InChIKey | BYLKWXQSXXJPLY-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 78.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.87 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|