C15H19F3N4O4S — CID 90099530
(1R,2S,4R,5R,6R)-2-(diethylamino)-4-[[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]sulfanyl]bicyclo[3.1.0]hexane-2,6-dicarboxylic acid (PubChem CID 90099530) has the molecular formula C15H19F3N4O4S and a molecular weight of 408.40 g/mol. Its IUPAC name is (1R,2S,4R,5R,6R)-2-(diethylamino)-4-[[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]sulfanyl]bicyclo[3.1.0]hexane-2,6-dicarboxylic acid.
| Compound Name | (1R,2S,4R,5R,6R)-2-(diethylamino)-4-[[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]sulfanyl]bicyclo[3.1.0]hexane-2,6-dicarboxylic acid |
|---|---|
| PubChem CID | 90099530 |
| Molecular Formula | C15H19F3N4O4S |
| Molecular Weight | 408.40 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | (1R,2S,4R,5R,6R)-2-(diethylamino)-4-[[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]sulfanyl]bicyclo[3.1.0]hexane-2,6-dicarboxylic acid |
| SMILES | CCN(CC)[C@@]1(C(=O)O)C[C@@H](Sc2n[nH]c(C(F)(F)F)n2)[C@H]2[C@H](C(=O)O)[C@H]21 |
| InChI | InChI=1S/C15H19F3N4O4S/c1-3-22(4-2)14(12(25)26)5-6(7-8(9(7)14)10(23)24)27-13-19-11(20-21-13)15(16,17)18/h6-9H,3-5H2,1-2H3,(H,23,24)(H,25,26)(H,19,20,21)/t6-,7+,8+,9+,14+/m1/s1 |
| InChIKey | KMTAQPROKPYKQS-DHGLKCJESA-N |
| XLogP | 1.80 |
| TPSA | 119.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.40 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |