About 2-benzofuran-1,3-dione;1,3-thiazol-2-amine
2-benzofuran-1,3-dione;1,3-thiazol-2-amine (PubChem CID 90099575) has the molecular formula C11H8N2O3S
and a molecular weight of 248.26 g/mol. Its IUPAC name is 2-benzofuran-1,3-dione;1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 2-benzofuran-1,3-dione;1,3-thiazol-2-amine |
| PubChem CID | 90099575 |
| Molecular Formula | C11H8N2O3S |
| Molecular Weight | 248.26 g/mol |
| Exact Mass | 248.03 |
| IUPAC Name | 2-benzofuran-1,3-dione;1,3-thiazol-2-amine |
| SMILES | Nc1nccs1.O=C1OC(=O)c2ccccc21 |
| InChI | InChI=1S/C8H4O3.C3H4N2S/c9-7-5-3-1-2-4-6(5)8(10)11-7;4-3-5-1-2-6-3/h1-4H;1-2H,(H2,4,5) |
| InChIKey | WZUIOIIPCIXPFX-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.26 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-benzofuran-1,3-dione;1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzofuran-1,3-dione;1,3-thiazol-2-amine?
The IUPAC name of 2-benzofuran-1,3-dione;1,3-thiazol-2-amine (CID 90099575) is 2-benzofuran-1,3-dione;1,3-thiazol-2-amine.
What is the SMILES notation for 2-benzofuran-1,3-dione;1,3-thiazol-2-amine?
The canonical SMILES for 2-benzofuran-1,3-dione;1,3-thiazol-2-amine is Nc1nccs1.O=C1OC(=O)c2ccccc21.
What is the InChIKey of 2-benzofuran-1,3-dione;1,3-thiazol-2-amine?
The InChIKey is WZUIOIIPCIXPFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4O3.C3H4N2S/c9-7-5-3-1-2-4-6(5)8(10)11-7;4-3-5-1-2-6-3/h1-4H;1-2H,(H2,4,5).
What are the key properties of 2-benzofuran-1,3-dione;1,3-thiazol-2-amine?
2-benzofuran-1,3-dione;1,3-thiazol-2-amine has a molecular weight of 248.26 g/mol, XLogP of 1.72, 0 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzofuran-1,3-dione;1,3-thiazol-2-amine is sourced from PubChem (CID 90099575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).