C58H68N18O2 — CID 90100085
1,2-bis[4-(5-methoxy-4-piperazin-1-ylpyrido[3,4-d]pyrimidin-2-yl)-2-pyridinyl]-1,2-bis[2-methyl-4-(4-methylpiperazin-1-yl)phenyl]hydrazine (PubChem CID 90100085) has the molecular formula C58H68N18O2 and a molecular weight of 1049.31 g/mol. Its IUPAC name is 1,2-bis[4-(5-methoxy-4-piperazin-1-ylpyrido[3,4-d]pyrimidin-2-yl)-2-pyridinyl]-1,2-bis[2-methyl-4-(4-methylpiperazin-1-yl)phenyl]hydrazine.
| Compound Name | 1,2-bis[4-(5-methoxy-4-piperazin-1-ylpyrido[3,4-d]pyrimidin-2-yl)-2-pyridinyl]-1,2-bis[2-methyl-4-(4-methylpiperazin-1-yl)phenyl]hydrazine |
|---|---|
| PubChem CID | 90100085 |
| Molecular Formula | C58H68N18O2 |
| Molecular Weight | 1049.31 g/mol |
| Exact Mass | 1048.58 |
| IUPAC Name | 1,2-bis[4-(5-methoxy-4-piperazin-1-ylpyrido[3,4-d]pyrimidin-2-yl)-2-pyridinyl]-1,2-bis[2-methyl-4-(4-methylpiperazin-1-yl)phenyl]hydrazine |
| SMILES | COc1cncc2nc(-c3ccnc(N(c4ccc(N5CCN(C)CC5)cc4C)N(c4cc(-c5nc(N6CCNCC6)c6c(OC)cncc6n5)ccn4)c4ccc(N5CCN(C)CC5)cc4C)c3)nc(N3CCNCC3)c12 |
| InChI | InChI=1S/C58H68N18O2/c1-39-31-43(71-27-23-69(3)24-28-71)7-9-47(39)75(51-33-41(11-13-63-51)55-65-45-35-61-37-49(77-5)53(45)57(67-55)73-19-15-59-16-20-73)76(48-10-8-44(32-40(48)2)72-29-25-70(4)26-30-72)52-34-42(12-14-64-52)56-66-46-36-62-38-50(78-6)54(46)58(68-56)74-21-17-60-18-22-74/h7-14,31-38,59-60H,15-30H2,1-6H3 |
| InChIKey | ANXGRSGGRPYVHK-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 171.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 78 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1049.31 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|