C56H62N16O4 — CID 90100161
1,2-bis[4-(5-methoxy-4-piperazin-1-ylpyrido[3,4-d]pyrimidin-2-yl)-2-pyridinyl]-1,2-bis(2-methyl-4-morpholin-4-ylphenyl)hydrazine (PubChem CID 90100161) has the molecular formula C56H62N16O4 and a molecular weight of 1023.22 g/mol. Its IUPAC name is 1,2-bis[4-(5-methoxy-4-piperazin-1-ylpyrido[3,4-d]pyrimidin-2-yl)-2-pyridinyl]-1,2-bis(2-methyl-4-morpholin-4-ylphenyl)hydrazine.
| Compound Name | 1,2-bis[4-(5-methoxy-4-piperazin-1-ylpyrido[3,4-d]pyrimidin-2-yl)-2-pyridinyl]-1,2-bis(2-methyl-4-morpholin-4-ylphenyl)hydrazine |
|---|---|
| PubChem CID | 90100161 |
| Molecular Formula | C56H62N16O4 |
| Molecular Weight | 1023.22 g/mol |
| Exact Mass | 1022.51 |
| IUPAC Name | 1,2-bis[4-(5-methoxy-4-piperazin-1-ylpyrido[3,4-d]pyrimidin-2-yl)-2-pyridinyl]-1,2-bis(2-methyl-4-morpholin-4-ylphenyl)hydrazine |
| SMILES | COc1cncc2nc(-c3ccnc(N(c4ccc(N5CCOCC5)cc4C)N(c4cc(-c5nc(N6CCNCC6)c6c(OC)cncc6n5)ccn4)c4ccc(N5CCOCC5)cc4C)c3)nc(N3CCNCC3)c12 |
| InChI | InChI=1S/C56H62N16O4/c1-37-29-41(67-21-25-75-26-22-67)5-7-45(37)71(49-31-39(9-11-61-49)53-63-43-33-59-35-47(73-3)51(43)55(65-53)69-17-13-57-14-18-69)72(46-8-6-42(30-38(46)2)68-23-27-76-28-24-68)50-32-40(10-12-62-50)54-64-44-34-60-36-48(74-4)52(44)56(66-54)70-19-15-58-16-20-70/h5-12,29-36,57-58H,13-28H2,1-4H3 |
| InChIKey | CKJAYSXFMUPMKM-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 183.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 76 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1023.22 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|