About [2-[4-(3,3-difluoropiperidin-4-yl)-2-methylpyrimidin-5-yl]-2-oxoethyl] acetate;hydrochloride
[2-[4-(3,3-difluoropiperidin-4-yl)-2-methylpyrimidin-5-yl]-2-oxoethyl] acetate;hydrochloride (PubChem CID 90100498) has the molecular formula C14H18ClF2N3O3
and a molecular weight of 349.77 g/mol. Its IUPAC name is [2-[4-(3,3-difluoropiperidin-4-yl)-2-methylpyrimidin-5-yl]-2-oxoethyl] acetate;hydrochloride.
Molecular Properties
| Compound Name | [2-[4-(3,3-difluoropiperidin-4-yl)-2-methylpyrimidin-5-yl]-2-oxoethyl] acetate;hydrochloride |
| PubChem CID | 90100498 |
| Molecular Formula | C14H18ClF2N3O3 |
| Molecular Weight | 349.77 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | [2-[4-(3,3-difluoropiperidin-4-yl)-2-methylpyrimidin-5-yl]-2-oxoethyl] acetate;hydrochloride |
| SMILES | CC(=O)OCC(=O)c1cnc(C)nc1C1CCNCC1(F)F.Cl |
| InChI | InChI=1S/C14H17F2N3O3.ClH/c1-8-18-5-10(12(21)6-22-9(2)20)13(19-8)11-3-4-17-7-14(11,15)16;/h5,11,17H,3-4,6-7H2,1-2H3;1H |
| InChIKey | PGKLTXIJZZGWEW-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.77 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-[4-(3,3-difluoropiperidin-4-yl)-2-methylpyrimidin-5-yl]-2-oxoethyl] acetate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[4-(3,3-difluoropiperidin-4-yl)-2-methylpyrimidin-5-yl]-2-oxoethyl] acetate;hydrochloride?
The IUPAC name of [2-[4-(3,3-difluoropiperidin-4-yl)-2-methylpyrimidin-5-yl]-2-oxoethyl] acetate;hydrochloride (CID 90100498) is [2-[4-(3,3-difluoropiperidin-4-yl)-2-methylpyrimidin-5-yl]-2-oxoethyl] acetate;hydrochloride.
What is the SMILES notation for [2-[4-(3,3-difluoropiperidin-4-yl)-2-methylpyrimidin-5-yl]-2-oxoethyl] acetate;hydrochloride?
The canonical SMILES for [2-[4-(3,3-difluoropiperidin-4-yl)-2-methylpyrimidin-5-yl]-2-oxoethyl] acetate;hydrochloride is CC(=O)OCC(=O)c1cnc(C)nc1C1CCNCC1(F)F.Cl.
What is the InChIKey of [2-[4-(3,3-difluoropiperidin-4-yl)-2-methylpyrimidin-5-yl]-2-oxoethyl] acetate;hydrochloride?
The InChIKey is PGKLTXIJZZGWEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17F2N3O3.ClH/c1-8-18-5-10(12(21)6-22-9(2)20)13(19-8)11-3-4-17-7-14(11,15)16;/h5,11,17H,3-4,6-7H2,1-2H3;1H.
What are the key properties of [2-[4-(3,3-difluoropiperidin-4-yl)-2-methylpyrimidin-5-yl]-2-oxoethyl] acetate;hydrochloride?
[2-[4-(3,3-difluoropiperidin-4-yl)-2-methylpyrimidin-5-yl]-2-oxoethyl] acetate;hydrochloride has a molecular weight of 349.77 g/mol, XLogP of 1.66, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[4-(3,3-difluoropiperidin-4-yl)-2-methylpyrimidin-5-yl]-2-oxoethyl] acetate;hydrochloride is sourced from PubChem (CID 90100498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).